C44H64N2O4 — CID 6692863
N-[[2-[4-[(2R,4R,5S,6S)-4-[(dioctylamino)methyl]-6-[4-(hydroxymethyl)phenyl]-5-methyl-1,3-dioxan-2-yl]phenyl]phenyl]methyl]acetamide (PubChem CID 6692863) has the molecular formula C44H64N2O4 and a molecular weight of 685.01 g/mol. Its IUPAC name is N-[[2-[4-[(2R,4R,5S,6S)-4-[(dioctylamino)methyl]-6-[4-(hydroxymethyl)phenyl]-5-methyl-1,3-dioxan-2-yl]phenyl]phenyl]methyl]acetamide.
| Compound Name | N-[[2-[4-[(2R,4R,5S,6S)-4-[(dioctylamino)methyl]-6-[4-(hydroxymethyl)phenyl]-5-methyl-1,3-dioxan-2-yl]phenyl]phenyl]methyl]acetamide |
|---|---|
| PubChem CID | 6692863 |
| Molecular Formula | C44H64N2O4 |
| Molecular Weight | 685.01 g/mol |
| Exact Mass | 684.49 |
| IUPAC Name | N-[[2-[4-[(2R,4R,5S,6S)-4-[(dioctylamino)methyl]-6-[4-(hydroxymethyl)phenyl]-5-methyl-1,3-dioxan-2-yl]phenyl]phenyl]methyl]acetamide |
| SMILES | CCCCCCCCN(CCCCCCCC)C[C@@H]1O[C@H](c2ccc(-c3ccccc3CNC(C)=O)cc2)OC(c2ccc(CO)cc2)[C@@H]1C |
| InChI | InChI=1S/C44H64N2O4/c1-5-7-9-11-13-17-29-46(30-18-14-12-10-8-6-2)32-42-34(3)43(38-23-21-36(33-47)22-24-38)50-44(49-42)39-27-25-37(26-28-39)41-20-16-15-19-40(41)31-45-35(4)48/h15-16,19-28,34,42-44,47H,5-14,17-18,29-33H2,1-4H3,(H,45,48)/t34-,42+,43?,44+/m1/s1 |
| InChIKey | YBYUWMZXSYVRHZ-BMAAAYFGSA-N |
| XLogP | 10.30 |
| TPSA | 71.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 685.01 |
| LogP ≤ 5 | 10.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|