C43H57F5N2O4 — CID 6687066
N-[[4-[(2S,4S,5R,6R)-4-[(dioctylamino)methyl]-6-[4-(hydroxymethyl)phenyl]-5-methyl-1,3-dioxan-2-yl]phenyl]methyl]-2,3,4,5,6-pentafluorobenzamide (PubChem CID 6687066) has the molecular formula C43H57F5N2O4 and a molecular weight of 760.93 g/mol. Its IUPAC name is N-[[4-[(2S,4S,5R,6R)-4-[(dioctylamino)methyl]-6-[4-(hydroxymethyl)phenyl]-5-methyl-1,3-dioxan-2-yl]phenyl]methyl]-2,3,4,5,6-pentafluorobenzamide.
| Compound Name | N-[[4-[(2S,4S,5R,6R)-4-[(dioctylamino)methyl]-6-[4-(hydroxymethyl)phenyl]-5-methyl-1,3-dioxan-2-yl]phenyl]methyl]-2,3,4,5,6-pentafluorobenzamide |
|---|---|
| PubChem CID | 6687066 |
| Molecular Formula | C43H57F5N2O4 |
| Molecular Weight | 760.93 g/mol |
| Exact Mass | 760.42 |
| IUPAC Name | N-[[4-[(2S,4S,5R,6R)-4-[(dioctylamino)methyl]-6-[4-(hydroxymethyl)phenyl]-5-methyl-1,3-dioxan-2-yl]phenyl]methyl]-2,3,4,5,6-pentafluorobenzamide |
| SMILES | CCCCCCCCN(CCCCCCCC)C[C@H]1O[C@@H](c2ccc(CNC(=O)c3c(F)c(F)c(F)c(F)c3F)cc2)O[C@@H](c2ccc(CO)cc2)[C@H]1C |
| InChI | InChI=1S/C43H57F5N2O4/c1-4-6-8-10-12-14-24-50(25-15-13-11-9-7-5-2)27-34-29(3)41(32-20-18-31(28-51)19-21-32)54-43(53-34)33-22-16-30(17-23-33)26-49-42(52)35-36(44)38(46)40(48)39(47)37(35)45/h16-23,29,34,41,43,51H,4-15,24-28H2,1-3H3,(H,49,52)/t29-,34+,41+,43+/m0/s1 |
| InChIKey | SYLXGFWPBKXROA-PLZMJAOBSA-N |
| XLogP | 10.62 |
| TPSA | 71.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 760.93 |
| LogP ≤ 5 | 10.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|