C37H58N2O4 — CID 6706172
N-[4-[(2R,4R,5S,6S)-4-[(dioctylamino)methyl]-6-[4-(hydroxymethyl)phenyl]-5-methyl-1,3-dioxan-2-yl]phenyl]acetamide (PubChem CID 6706172) has the molecular formula C37H58N2O4 and a molecular weight of 594.88 g/mol. Its IUPAC name is N-[4-[(2R,4R,5S,6S)-4-[(dioctylamino)methyl]-6-[4-(hydroxymethyl)phenyl]-5-methyl-1,3-dioxan-2-yl]phenyl]acetamide.
| Compound Name | N-[4-[(2R,4R,5S,6S)-4-[(dioctylamino)methyl]-6-[4-(hydroxymethyl)phenyl]-5-methyl-1,3-dioxan-2-yl]phenyl]acetamide |
|---|---|
| PubChem CID | 6706172 |
| Molecular Formula | C37H58N2O4 |
| Molecular Weight | 594.88 g/mol |
| Exact Mass | 594.44 |
| IUPAC Name | N-[4-[(2R,4R,5S,6S)-4-[(dioctylamino)methyl]-6-[4-(hydroxymethyl)phenyl]-5-methyl-1,3-dioxan-2-yl]phenyl]acetamide |
| SMILES | CCCCCCCCN(CCCCCCCC)C[C@@H]1O[C@H](c2ccc(NC(C)=O)cc2)OC(c2ccc(CO)cc2)[C@@H]1C |
| InChI | InChI=1S/C37H58N2O4/c1-5-7-9-11-13-15-25-39(26-16-14-12-10-8-6-2)27-35-29(3)36(32-19-17-31(28-40)18-20-32)43-37(42-35)33-21-23-34(24-22-33)38-30(4)41/h17-24,29,35-37,40H,5-16,25-28H2,1-4H3,(H,38,41)/t29-,35+,36?,37+/m1/s1 |
| InChIKey | LFNLMHUXAPHVKR-QQYKLCCVSA-N |
| XLogP | 8.95 |
| TPSA | 71.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.88 |
| LogP ≤ 5 | 8.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|