C42H60N2O4 — CID 6692786
N-[3-[(2R,4R,5S,6S)-4-[(dioctylamino)methyl]-6-[4-(hydroxymethyl)phenyl]-5-methyl-1,3-dioxan-2-yl]phenyl]benzamide (PubChem CID 6692786) has the molecular formula C42H60N2O4 and a molecular weight of 656.95 g/mol. Its IUPAC name is N-[3-[(2R,4R,5S,6S)-4-[(dioctylamino)methyl]-6-[4-(hydroxymethyl)phenyl]-5-methyl-1,3-dioxan-2-yl]phenyl]benzamide.
| Compound Name | N-[3-[(2R,4R,5S,6S)-4-[(dioctylamino)methyl]-6-[4-(hydroxymethyl)phenyl]-5-methyl-1,3-dioxan-2-yl]phenyl]benzamide |
|---|---|
| PubChem CID | 6692786 |
| Molecular Formula | C42H60N2O4 |
| Molecular Weight | 656.95 g/mol |
| Exact Mass | 656.46 |
| IUPAC Name | N-[3-[(2R,4R,5S,6S)-4-[(dioctylamino)methyl]-6-[4-(hydroxymethyl)phenyl]-5-methyl-1,3-dioxan-2-yl]phenyl]benzamide |
| SMILES | CCCCCCCCN(CCCCCCCC)C[C@@H]1O[C@H](c2cccc(NC(=O)c3ccccc3)c2)OC(c2ccc(CO)cc2)[C@@H]1C |
| InChI | InChI=1S/C42H60N2O4/c1-4-6-8-10-12-17-28-44(29-18-13-11-9-7-5-2)31-39-33(3)40(35-26-24-34(32-45)25-27-35)48-42(47-39)37-22-19-23-38(30-37)43-41(46)36-20-15-14-16-21-36/h14-16,19-27,30,33,39-40,42,45H,4-13,17-18,28-29,31-32H2,1-3H3,(H,43,46)/t33-,39+,40?,42+/m1/s1 |
| InChIKey | CAEXFXPSKDTTDQ-OUYJVBGSSA-N |
| XLogP | 10.25 |
| TPSA | 71.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 656.95 |
| LogP ≤ 5 | 10.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|