C36H40N2O5 — CID 6685086
N-[3-[(2S,4R,5R,6S)-4-[4-(hydroxymethyl)phenyl]-6-[[[(1S,2R)-1-hydroxy-1-phenylpropan-2-yl]-methylamino]methyl]-5-methyl-1,3-dioxan-2-yl]phenyl]benzamide (PubChem CID 6685086) has the molecular formula C36H40N2O5 and a molecular weight of 580.73 g/mol. Its IUPAC name is N-[3-[(2S,4R,5R,6S)-4-[4-(hydroxymethyl)phenyl]-6-[[[(1S,2R)-1-hydroxy-1-phenylpropan-2-yl]-methylamino]methyl]-5-methyl-1,3-dioxan-2-yl]phenyl]benzamide.
| Compound Name | N-[3-[(2S,4R,5R,6S)-4-[4-(hydroxymethyl)phenyl]-6-[[[(1S,2R)-1-hydroxy-1-phenylpropan-2-yl]-methylamino]methyl]-5-methyl-1,3-dioxan-2-yl]phenyl]benzamide |
|---|---|
| PubChem CID | 6685086 |
| Molecular Formula | C36H40N2O5 |
| Molecular Weight | 580.73 g/mol |
| Exact Mass | 580.29 |
| IUPAC Name | N-[3-[(2S,4R,5R,6S)-4-[4-(hydroxymethyl)phenyl]-6-[[[(1S,2R)-1-hydroxy-1-phenylpropan-2-yl]-methylamino]methyl]-5-methyl-1,3-dioxan-2-yl]phenyl]benzamide |
| SMILES | C[C@@H]1C(c2ccc(CO)cc2)O[C@H](c2cccc(NC(=O)c3ccccc3)c2)O[C@@H]1CN(C)[C@H](C)[C@@H](O)c1ccccc1 |
| InChI | InChI=1S/C36H40N2O5/c1-24-32(22-38(3)25(2)33(40)27-11-6-4-7-12-27)42-36(43-34(24)28-19-17-26(23-39)18-20-28)30-15-10-16-31(21-30)37-35(41)29-13-8-5-9-14-29/h4-21,24-25,32-34,36,39-40H,22-23H2,1-3H3,(H,37,41)/t24-,25+,32+,33+,34?,36+/m0/s1 |
| InChIKey | MBFALHFHAXELGK-PMHSLFMXSA-N |
| XLogP | 6.28 |
| TPSA | 91.26 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.73 |
| LogP ≤ 5 | 6.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |