C33H40N2O6 — CID 6690829
prop-2-enyl N-[3-[(2R,4S,5S,6R)-4-[4-(hydroxymethyl)phenyl]-6-[[[(1S,2R)-1-hydroxy-1-phenylpropan-2-yl]-methylamino]methyl]-5-methyl-1,3-dioxan-2-yl]phenyl]carbamate (PubChem CID 6690829) has the molecular formula C33H40N2O6 and a molecular weight of 560.69 g/mol. Its IUPAC name is prop-2-enyl N-[3-[(2R,4S,5S,6R)-4-[4-(hydroxymethyl)phenyl]-6-[[[(1S,2R)-1-hydroxy-1-phenylpropan-2-yl]-methylamino]methyl]-5-methyl-1,3-dioxan-2-yl]phenyl]carbamate.
| Compound Name | prop-2-enyl N-[3-[(2R,4S,5S,6R)-4-[4-(hydroxymethyl)phenyl]-6-[[[(1S,2R)-1-hydroxy-1-phenylpropan-2-yl]-methylamino]methyl]-5-methyl-1,3-dioxan-2-yl]phenyl]carbamate |
|---|---|
| PubChem CID | 6690829 |
| Molecular Formula | C33H40N2O6 |
| Molecular Weight | 560.69 g/mol |
| Exact Mass | 560.29 |
| IUPAC Name | prop-2-enyl N-[3-[(2R,4S,5S,6R)-4-[4-(hydroxymethyl)phenyl]-6-[[[(1S,2R)-1-hydroxy-1-phenylpropan-2-yl]-methylamino]methyl]-5-methyl-1,3-dioxan-2-yl]phenyl]carbamate |
| SMILES | C=CCOC(=O)Nc1cccc([C@@H]2OC(c3ccc(CO)cc3)[C@H](C)[C@H](CN(C)[C@H](C)[C@@H](O)c3ccccc3)O2)c1 |
| InChI | InChI=1S/C33H40N2O6/c1-5-18-39-33(38)34-28-13-9-12-27(19-28)32-40-29(20-35(4)23(3)30(37)25-10-7-6-8-11-25)22(2)31(41-32)26-16-14-24(21-36)15-17-26/h5-17,19,22-23,29-32,36-37H,1,18,20-21H2,2-4H3,(H,34,38)/t22-,23-,29+,30-,31?,32+/m1/s1 |
| InChIKey | CWSINRYWNHVSQS-IUMNTSICSA-N |
| XLogP | 5.76 |
| TPSA | 100.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.69 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|