C33H40N2O7 — CID 6690840
4-[3-[(2R,4S,5S,6R)-4-[4-(hydroxymethyl)phenyl]-6-[[[(1S,2R)-1-hydroxy-1-phenylpropan-2-yl]-methylamino]methyl]-5-methyl-1,3-dioxan-2-yl]anilino]-4-oxobutanoic acid (PubChem CID 6690840) has the molecular formula C33H40N2O7 and a molecular weight of 576.69 g/mol. Its IUPAC name is 4-[3-[(2R,4S,5S,6R)-4-[4-(hydroxymethyl)phenyl]-6-[[[(1S,2R)-1-hydroxy-1-phenylpropan-2-yl]-methylamino]methyl]-5-methyl-1,3-dioxan-2-yl]anilino]-4-oxobutanoic acid.
| Compound Name | 4-[3-[(2R,4S,5S,6R)-4-[4-(hydroxymethyl)phenyl]-6-[[[(1S,2R)-1-hydroxy-1-phenylpropan-2-yl]-methylamino]methyl]-5-methyl-1,3-dioxan-2-yl]anilino]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 6690840 |
| Molecular Formula | C33H40N2O7 |
| Molecular Weight | 576.69 g/mol |
| Exact Mass | 576.28 |
| IUPAC Name | 4-[3-[(2R,4S,5S,6R)-4-[4-(hydroxymethyl)phenyl]-6-[[[(1S,2R)-1-hydroxy-1-phenylpropan-2-yl]-methylamino]methyl]-5-methyl-1,3-dioxan-2-yl]anilino]-4-oxobutanoic acid |
| SMILES | C[C@H]([C@@H](O)c1ccccc1)N(C)C[C@@H]1O[C@H](c2cccc(NC(=O)CCC(=O)O)c2)OC(c2ccc(CO)cc2)[C@@H]1C |
| InChI | InChI=1S/C33H40N2O7/c1-21-28(19-35(3)22(2)31(40)24-8-5-4-6-9-24)41-33(42-32(21)25-14-12-23(20-36)13-15-25)26-10-7-11-27(18-26)34-29(37)16-17-30(38)39/h4-15,18,21-22,28,31-33,36,40H,16-17,19-20H2,1-3H3,(H,34,37)(H,38,39)/t21-,22-,28+,31-,32?,33+/m1/s1 |
| InChIKey | OVSFTBJCTNNVLU-JGAYDTBTSA-N |
| XLogP | 4.83 |
| TPSA | 128.56 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.69 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |