C30H33Cl3N2O4 — CID 6689566
2,2,2-trichloro-N-[3-[(2R,4S,5S,6R)-4-[4-(hydroxymethyl)phenyl]-5-methyl-6-[[methyl-[(1S)-1-phenylethyl]amino]methyl]-1,3-dioxan-2-yl]phenyl]acetamide (PubChem CID 6689566) has the molecular formula C30H33Cl3N2O4 and a molecular weight of 591.96 g/mol. Its IUPAC name is 2,2,2-trichloro-N-[3-[(2R,4S,5S,6R)-4-[4-(hydroxymethyl)phenyl]-5-methyl-6-[[methyl-[(1S)-1-phenylethyl]amino]methyl]-1,3-dioxan-2-yl]phenyl]acetamide.
| Compound Name | 2,2,2-trichloro-N-[3-[(2R,4S,5S,6R)-4-[4-(hydroxymethyl)phenyl]-5-methyl-6-[[methyl-[(1S)-1-phenylethyl]amino]methyl]-1,3-dioxan-2-yl]phenyl]acetamide |
|---|---|
| PubChem CID | 6689566 |
| Molecular Formula | C30H33Cl3N2O4 |
| Molecular Weight | 591.96 g/mol |
| Exact Mass | 590.15 |
| IUPAC Name | 2,2,2-trichloro-N-[3-[(2R,4S,5S,6R)-4-[4-(hydroxymethyl)phenyl]-5-methyl-6-[[methyl-[(1S)-1-phenylethyl]amino]methyl]-1,3-dioxan-2-yl]phenyl]acetamide |
| SMILES | C[C@H]1C(c2ccc(CO)cc2)O[C@@H](c2cccc(NC(=O)C(Cl)(Cl)Cl)c2)O[C@H]1CN(C)[C@@H](C)c1ccccc1 |
| InChI | InChI=1S/C30H33Cl3N2O4/c1-19-26(17-35(3)20(2)22-8-5-4-6-9-22)38-28(39-27(19)23-14-12-21(18-36)13-15-23)24-10-7-11-25(16-24)34-29(37)30(31,32)33/h4-16,19-20,26-28,36H,17-18H2,1-3H3,(H,34,37)/t19-,20+,26+,27?,28+/m1/s1 |
| InChIKey | HQHIHSGTJSPREA-JBPPMBEUSA-N |
| XLogP | 6.97 |
| TPSA | 71.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 591.96 |
| LogP ≤ 5 | 6.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|