C30H33Cl3N2O6 — CID 6691865
2,2,2-trichloro-N-[3-[(2R,4R,5S,6S)-4-[[[(2S)-2-hydroxy-2-(3-hydroxyphenyl)ethyl]-methylamino]methyl]-6-[4-(hydroxymethyl)phenyl]-5-methyl-1,3-dioxan-2-yl]phenyl]acetamide (PubChem CID 6691865) has the molecular formula C30H33Cl3N2O6 and a molecular weight of 623.96 g/mol. Its IUPAC name is 2,2,2-trichloro-N-[3-[(2R,4R,5S,6S)-4-[[[(2S)-2-hydroxy-2-(3-hydroxyphenyl)ethyl]-methylamino]methyl]-6-[4-(hydroxymethyl)phenyl]-5-methyl-1,3-dioxan-2-yl]phenyl]acetamide.
| Compound Name | 2,2,2-trichloro-N-[3-[(2R,4R,5S,6S)-4-[[[(2S)-2-hydroxy-2-(3-hydroxyphenyl)ethyl]-methylamino]methyl]-6-[4-(hydroxymethyl)phenyl]-5-methyl-1,3-dioxan-2-yl]phenyl]acetamide |
|---|---|
| PubChem CID | 6691865 |
| Molecular Formula | C30H33Cl3N2O6 |
| Molecular Weight | 623.96 g/mol |
| Exact Mass | 622.14 |
| IUPAC Name | 2,2,2-trichloro-N-[3-[(2R,4R,5S,6S)-4-[[[(2S)-2-hydroxy-2-(3-hydroxyphenyl)ethyl]-methylamino]methyl]-6-[4-(hydroxymethyl)phenyl]-5-methyl-1,3-dioxan-2-yl]phenyl]acetamide |
| SMILES | C[C@H]1C(c2ccc(CO)cc2)O[C@@H](c2cccc(NC(=O)C(Cl)(Cl)Cl)c2)O[C@H]1CN(C)C[C@@H](O)c1cccc(O)c1 |
| InChI | InChI=1S/C30H33Cl3N2O6/c1-18-26(16-35(2)15-25(38)21-5-4-8-24(37)14-21)40-28(41-27(18)20-11-9-19(17-36)10-12-20)22-6-3-7-23(13-22)34-29(39)30(31,32)33/h3-14,18,25-28,36-38H,15-17H2,1-2H3,(H,34,39)/t18-,25-,26+,27?,28+/m1/s1 |
| InChIKey | BLFCTMSGFWQAOI-SQSLCSDPSA-N |
| XLogP | 5.65 |
| TPSA | 111.49 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 623.96 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|