C36H36N2O7 — CID 6686131
2-[3-[(2S,4S,5R,6R)-4-[[[(2S)-2-hydroxy-2-(3-hydroxyphenyl)ethyl]-methylamino]methyl]-6-[4-(hydroxymethyl)phenyl]-5-methyl-1,3-dioxan-2-yl]phenyl]isoindole-1,3-dione (PubChem CID 6686131) has the molecular formula C36H36N2O7 and a molecular weight of 608.69 g/mol. Its IUPAC name is 2-[3-[(2S,4S,5R,6R)-4-[[[(2S)-2-hydroxy-2-(3-hydroxyphenyl)ethyl]-methylamino]methyl]-6-[4-(hydroxymethyl)phenyl]-5-methyl-1,3-dioxan-2-yl]phenyl]isoindole-1,3-dione.
| Compound Name | 2-[3-[(2S,4S,5R,6R)-4-[[[(2S)-2-hydroxy-2-(3-hydroxyphenyl)ethyl]-methylamino]methyl]-6-[4-(hydroxymethyl)phenyl]-5-methyl-1,3-dioxan-2-yl]phenyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 6686131 |
| Molecular Formula | C36H36N2O7 |
| Molecular Weight | 608.69 g/mol |
| Exact Mass | 608.25 |
| IUPAC Name | 2-[3-[(2S,4S,5R,6R)-4-[[[(2S)-2-hydroxy-2-(3-hydroxyphenyl)ethyl]-methylamino]methyl]-6-[4-(hydroxymethyl)phenyl]-5-methyl-1,3-dioxan-2-yl]phenyl]isoindole-1,3-dione |
| SMILES | C[C@H]1[C@@H](CN(C)C[C@@H](O)c2cccc(O)c2)O[C@@H](c2cccc(N3C(=O)c4ccccc4C3=O)c2)O[C@H]1c1ccc(CO)cc1 |
| InChI | InChI=1S/C36H36N2O7/c1-22-32(20-37(2)19-31(41)25-7-6-10-28(40)18-25)44-36(45-33(22)24-15-13-23(21-39)14-16-24)26-8-5-9-27(17-26)38-34(42)29-11-3-4-12-30(29)35(38)43/h3-18,22,31-33,36,39-41H,19-21H2,1-2H3/t22-,31+,32+,33+,36+/m0/s1 |
| InChIKey | SGBUQVPCZDJILB-YIMZRPJCSA-N |
| XLogP | 5.14 |
| TPSA | 119.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 608.69 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|