C33H40N2O7 — CID 6691887
prop-2-enyl N-[[4-[(2R,4R,5S,6S)-4-[[[(2S)-2-hydroxy-2-(3-hydroxyphenyl)ethyl]-methylamino]methyl]-6-[4-(hydroxymethyl)phenyl]-5-methyl-1,3-dioxan-2-yl]phenyl]methyl]carbamate (PubChem CID 6691887) has the molecular formula C33H40N2O7 and a molecular weight of 576.69 g/mol. Its IUPAC name is prop-2-enyl N-[[4-[(2R,4R,5S,6S)-4-[[[(2S)-2-hydroxy-2-(3-hydroxyphenyl)ethyl]-methylamino]methyl]-6-[4-(hydroxymethyl)phenyl]-5-methyl-1,3-dioxan-2-yl]phenyl]methyl]carbamate.
| Compound Name | prop-2-enyl N-[[4-[(2R,4R,5S,6S)-4-[[[(2S)-2-hydroxy-2-(3-hydroxyphenyl)ethyl]-methylamino]methyl]-6-[4-(hydroxymethyl)phenyl]-5-methyl-1,3-dioxan-2-yl]phenyl]methyl]carbamate |
|---|---|
| PubChem CID | 6691887 |
| Molecular Formula | C33H40N2O7 |
| Molecular Weight | 576.69 g/mol |
| Exact Mass | 576.28 |
| IUPAC Name | prop-2-enyl N-[[4-[(2R,4R,5S,6S)-4-[[[(2S)-2-hydroxy-2-(3-hydroxyphenyl)ethyl]-methylamino]methyl]-6-[4-(hydroxymethyl)phenyl]-5-methyl-1,3-dioxan-2-yl]phenyl]methyl]carbamate |
| SMILES | C=CCOC(=O)NCc1ccc([C@@H]2OC(c3ccc(CO)cc3)[C@H](C)[C@H](CN(C)C[C@@H](O)c3cccc(O)c3)O2)cc1 |
| InChI | InChI=1S/C33H40N2O7/c1-4-16-40-33(39)34-18-23-8-14-26(15-9-23)32-41-30(20-35(3)19-29(38)27-6-5-7-28(37)17-27)22(2)31(42-32)25-12-10-24(21-36)11-13-25/h4-15,17,22,29-32,36-38H,1,16,18-21H2,2-3H3,(H,34,39)/t22-,29-,30+,31?,32+/m1/s1 |
| InChIKey | GRXCFTPESDPLPU-FORCBRIESA-N |
| XLogP | 4.75 |
| TPSA | 120.72 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.69 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|