C36H41N3O6 — CID 6706007
1-benzyl-3-[4-[(2R,4R,5S,6S)-4-[[[(2S)-2-hydroxy-2-(3-hydroxyphenyl)ethyl]-methylamino]methyl]-6-[4-(hydroxymethyl)phenyl]-5-methyl-1,3-dioxan-2-yl]phenyl]urea (PubChem CID 6706007) has the molecular formula C36H41N3O6 and a molecular weight of 611.74 g/mol. Its IUPAC name is 1-benzyl-3-[4-[(2R,4R,5S,6S)-4-[[[(2S)-2-hydroxy-2-(3-hydroxyphenyl)ethyl]-methylamino]methyl]-6-[4-(hydroxymethyl)phenyl]-5-methyl-1,3-dioxan-2-yl]phenyl]urea.
| Compound Name | 1-benzyl-3-[4-[(2R,4R,5S,6S)-4-[[[(2S)-2-hydroxy-2-(3-hydroxyphenyl)ethyl]-methylamino]methyl]-6-[4-(hydroxymethyl)phenyl]-5-methyl-1,3-dioxan-2-yl]phenyl]urea |
|---|---|
| PubChem CID | 6706007 |
| Molecular Formula | C36H41N3O6 |
| Molecular Weight | 611.74 g/mol |
| Exact Mass | 611.30 |
| IUPAC Name | 1-benzyl-3-[4-[(2R,4R,5S,6S)-4-[[[(2S)-2-hydroxy-2-(3-hydroxyphenyl)ethyl]-methylamino]methyl]-6-[4-(hydroxymethyl)phenyl]-5-methyl-1,3-dioxan-2-yl]phenyl]urea |
| SMILES | C[C@H]1C(c2ccc(CO)cc2)O[C@@H](c2ccc(NC(=O)NCc3ccccc3)cc2)O[C@H]1CN(C)C[C@@H](O)c1cccc(O)c1 |
| InChI | InChI=1S/C36H41N3O6/c1-24-33(22-39(2)21-32(42)29-9-6-10-31(41)19-29)44-35(45-34(24)27-13-11-26(23-40)12-14-27)28-15-17-30(18-16-28)38-36(43)37-20-25-7-4-3-5-8-25/h3-19,24,32-35,40-42H,20-23H2,1-2H3,(H2,37,38,43)/t24-,32-,33+,34?,35+/m1/s1 |
| InChIKey | WZJGGZXWYYHEKI-GKCHVTHMSA-N |
| XLogP | 5.66 |
| TPSA | 123.52 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 611.74 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |