C31H35Cl3N2O6 — CID 6691888
2,2,2-trichloro-N-[[4-[(2R,4R,5S,6S)-4-[[[(2S)-2-hydroxy-2-(3-hydroxyphenyl)ethyl]-methylamino]methyl]-6-[4-(hydroxymethyl)phenyl]-5-methyl-1,3-dioxan-2-yl]phenyl]methyl]acetamide (PubChem CID 6691888) has the molecular formula C31H35Cl3N2O6 and a molecular weight of 637.99 g/mol. Its IUPAC name is 2,2,2-trichloro-N-[[4-[(2R,4R,5S,6S)-4-[[[(2S)-2-hydroxy-2-(3-hydroxyphenyl)ethyl]-methylamino]methyl]-6-[4-(hydroxymethyl)phenyl]-5-methyl-1,3-dioxan-2-yl]phenyl]methyl]acetamide.
| Compound Name | 2,2,2-trichloro-N-[[4-[(2R,4R,5S,6S)-4-[[[(2S)-2-hydroxy-2-(3-hydroxyphenyl)ethyl]-methylamino]methyl]-6-[4-(hydroxymethyl)phenyl]-5-methyl-1,3-dioxan-2-yl]phenyl]methyl]acetamide |
|---|---|
| PubChem CID | 6691888 |
| Molecular Formula | C31H35Cl3N2O6 |
| Molecular Weight | 637.99 g/mol |
| Exact Mass | 636.16 |
| IUPAC Name | 2,2,2-trichloro-N-[[4-[(2R,4R,5S,6S)-4-[[[(2S)-2-hydroxy-2-(3-hydroxyphenyl)ethyl]-methylamino]methyl]-6-[4-(hydroxymethyl)phenyl]-5-methyl-1,3-dioxan-2-yl]phenyl]methyl]acetamide |
| SMILES | C[C@H]1C(c2ccc(CO)cc2)O[C@@H](c2ccc(CNC(=O)C(Cl)(Cl)Cl)cc2)O[C@H]1CN(C)C[C@@H](O)c1cccc(O)c1 |
| InChI | InChI=1S/C31H35Cl3N2O6/c1-19-27(17-36(2)16-26(39)24-4-3-5-25(38)14-24)41-29(42-28(19)22-10-8-21(18-37)9-11-22)23-12-6-20(7-13-23)15-35-30(40)31(32,33)34/h3-14,19,26-29,37-39H,15-18H2,1-2H3,(H,35,40)/t19-,26-,27+,28?,29+/m1/s1 |
| InChIKey | IKFQUOOBABRDMY-KEKOVRHISA-N |
| XLogP | 5.33 |
| TPSA | 111.49 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 637.99 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|