C43H63N3O4 — CID 6692805
1-benzyl-3-[3-[(2R,4R,5S,6S)-4-[(dioctylamino)methyl]-6-[4-(hydroxymethyl)phenyl]-5-methyl-1,3-dioxan-2-yl]phenyl]urea (PubChem CID 6692805) has the molecular formula C43H63N3O4 and a molecular weight of 685.99 g/mol. Its IUPAC name is 1-benzyl-3-[3-[(2R,4R,5S,6S)-4-[(dioctylamino)methyl]-6-[4-(hydroxymethyl)phenyl]-5-methyl-1,3-dioxan-2-yl]phenyl]urea.
| Compound Name | 1-benzyl-3-[3-[(2R,4R,5S,6S)-4-[(dioctylamino)methyl]-6-[4-(hydroxymethyl)phenyl]-5-methyl-1,3-dioxan-2-yl]phenyl]urea |
|---|---|
| PubChem CID | 6692805 |
| Molecular Formula | C43H63N3O4 |
| Molecular Weight | 685.99 g/mol |
| Exact Mass | 685.48 |
| IUPAC Name | 1-benzyl-3-[3-[(2R,4R,5S,6S)-4-[(dioctylamino)methyl]-6-[4-(hydroxymethyl)phenyl]-5-methyl-1,3-dioxan-2-yl]phenyl]urea |
| SMILES | CCCCCCCCN(CCCCCCCC)C[C@@H]1O[C@H](c2cccc(NC(=O)NCc3ccccc3)c2)OC(c2ccc(CO)cc2)[C@@H]1C |
| InChI | InChI=1S/C43H63N3O4/c1-4-6-8-10-12-17-28-46(29-18-13-11-9-7-5-2)32-40-34(3)41(37-26-24-36(33-47)25-27-37)50-42(49-40)38-22-19-23-39(30-38)45-43(48)44-31-35-20-15-14-16-21-35/h14-16,19-27,30,34,40-42,47H,4-13,17-18,28-29,31-33H2,1-3H3,(H2,44,45,48)/t34-,40+,41?,42+/m1/s1 |
| InChIKey | DCVUNQOQVBCZFE-AUBFWJRWSA-N |
| XLogP | 10.31 |
| TPSA | 83.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 685.99 |
| LogP ≤ 5 | 10.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|