C44H51N3O4 — CID 6691769
1-(1-adamantyl)-3-[3-[(2R,4R,5S,6S)-4-[(dibenzylamino)methyl]-6-[4-(hydroxymethyl)phenyl]-5-methyl-1,3-dioxan-2-yl]phenyl]urea (PubChem CID 6691769) has the molecular formula C44H51N3O4 and a molecular weight of 685.91 g/mol. Its IUPAC name is 1-(1-adamantyl)-3-[3-[(2R,4R,5S,6S)-4-[(dibenzylamino)methyl]-6-[4-(hydroxymethyl)phenyl]-5-methyl-1,3-dioxan-2-yl]phenyl]urea.
| Compound Name | 1-(1-adamantyl)-3-[3-[(2R,4R,5S,6S)-4-[(dibenzylamino)methyl]-6-[4-(hydroxymethyl)phenyl]-5-methyl-1,3-dioxan-2-yl]phenyl]urea |
|---|---|
| PubChem CID | 6691769 |
| Molecular Formula | C44H51N3O4 |
| Molecular Weight | 685.91 g/mol |
| Exact Mass | 685.39 |
| IUPAC Name | 1-(1-adamantyl)-3-[3-[(2R,4R,5S,6S)-4-[(dibenzylamino)methyl]-6-[4-(hydroxymethyl)phenyl]-5-methyl-1,3-dioxan-2-yl]phenyl]urea |
| SMILES | C[C@@H]1[C@H](CN(Cc2ccccc2)Cc2ccccc2)O[C@H](c2cccc(NC(=O)NC34CC5CC(CC(C5)C3)C4)c2)O[C@@H]1c1ccc(CO)cc1 |
| InChI | InChI=1S/C44H51N3O4/c1-30-40(28-47(26-31-9-4-2-5-10-31)27-32-11-6-3-7-12-32)50-42(51-41(30)37-17-15-33(29-48)16-18-37)38-13-8-14-39(22-38)45-43(49)46-44-23-34-19-35(24-44)21-36(20-34)25-44/h2-18,22,30,34-36,40-42,48H,19-21,23-29H2,1H3,(H2,45,46,49)/t30-,34?,35?,36?,40+,41+,42+,44?/m1/s1 |
| InChIKey | MIRHHCDTMHKJQO-ILYXJQNHSA-N |
| XLogP | 8.76 |
| TPSA | 83.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 685.91 |
| LogP ≤ 5 | 8.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |