C38H47N3O4 — CID 6704378
1-(1-adamantyl)-3-[4-[(2S,4S,5R,6R)-4-[[benzyl(methyl)amino]methyl]-6-[4-(hydroxymethyl)phenyl]-5-methyl-1,3-dioxan-2-yl]phenyl]urea (PubChem CID 6704378) has the molecular formula C38H47N3O4 and a molecular weight of 609.81 g/mol. Its IUPAC name is 1-(1-adamantyl)-3-[4-[(2S,4S,5R,6R)-4-[[benzyl(methyl)amino]methyl]-6-[4-(hydroxymethyl)phenyl]-5-methyl-1,3-dioxan-2-yl]phenyl]urea.
| Compound Name | 1-(1-adamantyl)-3-[4-[(2S,4S,5R,6R)-4-[[benzyl(methyl)amino]methyl]-6-[4-(hydroxymethyl)phenyl]-5-methyl-1,3-dioxan-2-yl]phenyl]urea |
|---|---|
| PubChem CID | 6704378 |
| Molecular Formula | C38H47N3O4 |
| Molecular Weight | 609.81 g/mol |
| Exact Mass | 609.36 |
| IUPAC Name | 1-(1-adamantyl)-3-[4-[(2S,4S,5R,6R)-4-[[benzyl(methyl)amino]methyl]-6-[4-(hydroxymethyl)phenyl]-5-methyl-1,3-dioxan-2-yl]phenyl]urea |
| SMILES | C[C@H]1[C@@H](CN(C)Cc2ccccc2)O[C@@H](c2ccc(NC(=O)NC34CC5CC(CC(C5)C3)C4)cc2)O[C@H]1c1ccc(CO)cc1 |
| InChI | InChI=1S/C38H47N3O4/c1-25-34(23-41(2)22-26-6-4-3-5-7-26)44-36(45-35(25)31-10-8-27(24-42)9-11-31)32-12-14-33(15-13-32)39-37(43)40-38-19-28-16-29(20-38)18-30(17-28)21-38/h3-15,25,28-30,34-36,42H,16-24H2,1-2H3,(H2,39,40,43)/t25-,28?,29?,30?,34+,35+,36+,38?/m0/s1 |
| InChIKey | IXTDQDGSDLQLNQ-PBWUOCIRSA-N |
| XLogP | 7.19 |
| TPSA | 83.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 609.81 |
| LogP ≤ 5 | 7.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |