C29H31Cl3N2O4 — CID 6705459
N-[4-[(2R,4R,5S,6S)-4-[[benzyl(methyl)amino]methyl]-6-[4-(hydroxymethyl)phenyl]-5-methyl-1,3-dioxan-2-yl]phenyl]-2,2,2-trichloroacetamide (PubChem CID 6705459) has the molecular formula C29H31Cl3N2O4 and a molecular weight of 577.94 g/mol. Its IUPAC name is N-[4-[(2R,4R,5S,6S)-4-[[benzyl(methyl)amino]methyl]-6-[4-(hydroxymethyl)phenyl]-5-methyl-1,3-dioxan-2-yl]phenyl]-2,2,2-trichloroacetamide.
| Compound Name | N-[4-[(2R,4R,5S,6S)-4-[[benzyl(methyl)amino]methyl]-6-[4-(hydroxymethyl)phenyl]-5-methyl-1,3-dioxan-2-yl]phenyl]-2,2,2-trichloroacetamide |
|---|---|
| PubChem CID | 6705459 |
| Molecular Formula | C29H31Cl3N2O4 |
| Molecular Weight | 577.94 g/mol |
| Exact Mass | 576.13 |
| IUPAC Name | N-[4-[(2R,4R,5S,6S)-4-[[benzyl(methyl)amino]methyl]-6-[4-(hydroxymethyl)phenyl]-5-methyl-1,3-dioxan-2-yl]phenyl]-2,2,2-trichloroacetamide |
| SMILES | C[C@H]1C(c2ccc(CO)cc2)O[C@@H](c2ccc(NC(=O)C(Cl)(Cl)Cl)cc2)O[C@H]1CN(C)Cc1ccccc1 |
| InChI | InChI=1S/C29H31Cl3N2O4/c1-19-25(17-34(2)16-20-6-4-3-5-7-20)37-27(38-26(19)22-10-8-21(18-35)9-11-22)23-12-14-24(15-13-23)33-28(36)29(30,31)32/h3-15,19,25-27,35H,16-18H2,1-2H3,(H,33,36)/t19-,25+,26?,27+/m1/s1 |
| InChIKey | QBTSSDQOUTZYEG-ZHFGZPRMSA-N |
| XLogP | 6.41 |
| TPSA | 71.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.94 |
| LogP ≤ 5 | 6.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|