C45H53N3O4 — CID 6683450
1-(1-adamantyl)-3-[[2-[4-[(2S,4S,5R,6R)-4-[[benzyl(methyl)amino]methyl]-6-[4-(hydroxymethyl)phenyl]-5-methyl-1,3-dioxan-2-yl]phenyl]phenyl]methyl]urea (PubChem CID 6683450) has the molecular formula C45H53N3O4 and a molecular weight of 699.94 g/mol. Its IUPAC name is 1-(1-adamantyl)-3-[[2-[4-[(2S,4S,5R,6R)-4-[[benzyl(methyl)amino]methyl]-6-[4-(hydroxymethyl)phenyl]-5-methyl-1,3-dioxan-2-yl]phenyl]phenyl]methyl]urea.
| Compound Name | 1-(1-adamantyl)-3-[[2-[4-[(2S,4S,5R,6R)-4-[[benzyl(methyl)amino]methyl]-6-[4-(hydroxymethyl)phenyl]-5-methyl-1,3-dioxan-2-yl]phenyl]phenyl]methyl]urea |
|---|---|
| PubChem CID | 6683450 |
| Molecular Formula | C45H53N3O4 |
| Molecular Weight | 699.94 g/mol |
| Exact Mass | 699.40 |
| IUPAC Name | 1-(1-adamantyl)-3-[[2-[4-[(2S,4S,5R,6R)-4-[[benzyl(methyl)amino]methyl]-6-[4-(hydroxymethyl)phenyl]-5-methyl-1,3-dioxan-2-yl]phenyl]phenyl]methyl]urea |
| SMILES | C[C@H]1[C@@H](CN(C)Cc2ccccc2)O[C@@H](c2ccc(-c3ccccc3CNC(=O)NC34CC5CC(CC(C5)C3)C4)cc2)O[C@H]1c1ccc(CO)cc1 |
| InChI | InChI=1S/C45H53N3O4/c1-30-41(28-48(2)27-31-8-4-3-5-9-31)51-43(52-42(30)37-14-12-32(29-49)13-15-37)38-18-16-36(17-19-38)40-11-7-6-10-39(40)26-46-44(50)47-45-23-33-20-34(24-45)22-35(21-33)25-45/h3-19,30,33-35,41-43,49H,20-29H2,1-2H3,(H2,46,47,50)/t30-,33?,34?,35?,41+,42+,43+,45?/m0/s1 |
| InChIKey | YAYNDFOXXPPBEX-DSDALXMKSA-N |
| XLogP | 8.54 |
| TPSA | 83.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 699.94 |
| LogP ≤ 5 | 8.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |