C39H45N5O4S — CID 6687930
1-(1-adamantyl)-3-[[2-[4-[(2R,4S,5S,6R)-4-[4-(hydroxymethyl)phenyl]-5-methyl-6-(1H-1,2,4-triazol-5-ylsulfanylmethyl)-1,3-dioxan-2-yl]phenyl]phenyl]methyl]urea (PubChem CID 6687930) has the molecular formula C39H45N5O4S and a molecular weight of 679.89 g/mol. Its IUPAC name is 1-(1-adamantyl)-3-[[2-[4-[(2R,4S,5S,6R)-4-[4-(hydroxymethyl)phenyl]-5-methyl-6-(1H-1,2,4-triazol-5-ylsulfanylmethyl)-1,3-dioxan-2-yl]phenyl]phenyl]methyl]urea.
| Compound Name | 1-(1-adamantyl)-3-[[2-[4-[(2R,4S,5S,6R)-4-[4-(hydroxymethyl)phenyl]-5-methyl-6-(1H-1,2,4-triazol-5-ylsulfanylmethyl)-1,3-dioxan-2-yl]phenyl]phenyl]methyl]urea |
|---|---|
| PubChem CID | 6687930 |
| Molecular Formula | C39H45N5O4S |
| Molecular Weight | 679.89 g/mol |
| Exact Mass | 679.32 |
| IUPAC Name | 1-(1-adamantyl)-3-[[2-[4-[(2R,4S,5S,6R)-4-[4-(hydroxymethyl)phenyl]-5-methyl-6-(1H-1,2,4-triazol-5-ylsulfanylmethyl)-1,3-dioxan-2-yl]phenyl]phenyl]methyl]urea |
| SMILES | C[C@@H]1[C@H](CSc2ncn[nH]2)O[C@H](c2ccc(-c3ccccc3CNC(=O)NC34CC5CC(CC(C5)C3)C4)cc2)O[C@@H]1c1ccc(CO)cc1 |
| InChI | InChI=1S/C39H45N5O4S/c1-24-34(22-49-38-41-23-42-44-38)47-36(48-35(24)30-8-6-25(21-45)7-9-30)31-12-10-29(11-13-31)33-5-3-2-4-32(33)20-40-37(46)43-39-17-26-14-27(18-39)16-28(15-26)19-39/h2-13,23-24,26-28,34-36,45H,14-22H2,1H3,(H2,40,43,46)(H,41,42,44)/t24-,26?,27?,28?,34+,35+,36+,39?/m1/s1 |
| InChIKey | FEXUZTWTUNOFAU-IETUJEAESA-N |
| XLogP | 7.32 |
| TPSA | 121.39 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 679.89 |
| LogP ≤ 5 | 7.32 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |