C41H48N4O4S — CID 6682876
1-(1-adamantyl)-3-[[2-[4-[(2S,4R,5R,6S)-4-[4-(hydroxymethyl)phenyl]-5-methyl-6-[(1-methylimidazol-2-yl)sulfanylmethyl]-1,3-dioxan-2-yl]phenyl]phenyl]methyl]urea (PubChem CID 6682876) has the molecular formula C41H48N4O4S and a molecular weight of 692.93 g/mol. Its IUPAC name is 1-(1-adamantyl)-3-[[2-[4-[(2S,4R,5R,6S)-4-[4-(hydroxymethyl)phenyl]-5-methyl-6-[(1-methylimidazol-2-yl)sulfanylmethyl]-1,3-dioxan-2-yl]phenyl]phenyl]methyl]urea.
| Compound Name | 1-(1-adamantyl)-3-[[2-[4-[(2S,4R,5R,6S)-4-[4-(hydroxymethyl)phenyl]-5-methyl-6-[(1-methylimidazol-2-yl)sulfanylmethyl]-1,3-dioxan-2-yl]phenyl]phenyl]methyl]urea |
|---|---|
| PubChem CID | 6682876 |
| Molecular Formula | C41H48N4O4S |
| Molecular Weight | 692.93 g/mol |
| Exact Mass | 692.34 |
| IUPAC Name | 1-(1-adamantyl)-3-[[2-[4-[(2S,4R,5R,6S)-4-[4-(hydroxymethyl)phenyl]-5-methyl-6-[(1-methylimidazol-2-yl)sulfanylmethyl]-1,3-dioxan-2-yl]phenyl]phenyl]methyl]urea |
| SMILES | C[C@H]1[C@@H](CSc2nccn2C)O[C@@H](c2ccc(-c3ccccc3CNC(=O)NC34CC5CC(CC(C5)C3)C4)cc2)O[C@H]1c1ccc(CO)cc1 |
| InChI | InChI=1S/C41H48N4O4S/c1-26-36(25-50-40-42-15-16-45(40)2)48-38(49-37(26)32-9-7-27(24-46)8-10-32)33-13-11-31(12-14-33)35-6-4-3-5-34(35)23-43-39(47)44-41-20-28-17-29(21-41)19-30(18-28)22-41/h3-16,26,28-30,36-38,46H,17-25H2,1-2H3,(H2,43,44,47)/t26-,28?,29?,30?,36+,37+,38+,41?/m0/s1 |
| InChIKey | KJKMFZFZOMWOHC-UJEPKEDMSA-N |
| XLogP | 7.93 |
| TPSA | 97.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 692.93 |
| LogP ≤ 5 | 7.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |