C51H57N3O4 — CID 6691815
1-(1-adamantyl)-3-[[3-[4-[(2R,4R,5S,6S)-4-[(dibenzylamino)methyl]-6-[4-(hydroxymethyl)phenyl]-5-methyl-1,3-dioxan-2-yl]phenyl]phenyl]methyl]urea (PubChem CID 6691815) has the molecular formula C51H57N3O4 and a molecular weight of 776.03 g/mol. Its IUPAC name is 1-(1-adamantyl)-3-[[3-[4-[(2R,4R,5S,6S)-4-[(dibenzylamino)methyl]-6-[4-(hydroxymethyl)phenyl]-5-methyl-1,3-dioxan-2-yl]phenyl]phenyl]methyl]urea.
| Compound Name | 1-(1-adamantyl)-3-[[3-[4-[(2R,4R,5S,6S)-4-[(dibenzylamino)methyl]-6-[4-(hydroxymethyl)phenyl]-5-methyl-1,3-dioxan-2-yl]phenyl]phenyl]methyl]urea |
|---|---|
| PubChem CID | 6691815 |
| Molecular Formula | C51H57N3O4 |
| Molecular Weight | 776.03 g/mol |
| Exact Mass | 775.43 |
| IUPAC Name | 1-(1-adamantyl)-3-[[3-[4-[(2R,4R,5S,6S)-4-[(dibenzylamino)methyl]-6-[4-(hydroxymethyl)phenyl]-5-methyl-1,3-dioxan-2-yl]phenyl]phenyl]methyl]urea |
| SMILES | C[C@@H]1[C@H](CN(Cc2ccccc2)Cc2ccccc2)O[C@H](c2ccc(-c3cccc(CNC(=O)NC45CC6CC(CC(C6)C4)C5)c3)cc2)O[C@@H]1c1ccc(CO)cc1 |
| InChI | InChI=1S/C51H57N3O4/c1-35-47(33-54(31-36-9-4-2-5-10-36)32-37-11-6-3-7-12-37)57-49(58-48(35)44-17-15-38(34-55)16-18-44)45-21-19-43(20-22-45)46-14-8-13-39(26-46)30-52-50(56)53-51-27-40-23-41(28-51)25-42(24-40)29-51/h2-22,26,35,40-42,47-49,55H,23-25,27-34H2,1H3,(H2,52,53,56)/t35-,40?,41?,42?,47+,48+,49+,51?/m1/s1 |
| InChIKey | YRLGLEVETHKUNG-OUKXBQHHSA-N |
| XLogP | 10.11 |
| TPSA | 83.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 776.03 |
| LogP ≤ 5 | 10.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |