C42H53N3O4 — CID 6681820
1-(1-adamantyl)-3-[[3-[4-[(2S,4R,5R,6S)-4-[4-(hydroxymethyl)phenyl]-5-methyl-6-(piperidin-1-ylmethyl)-1,3-dioxan-2-yl]phenyl]phenyl]methyl]urea (PubChem CID 6681820) has the molecular formula C42H53N3O4 and a molecular weight of 663.90 g/mol. Its IUPAC name is 1-(1-adamantyl)-3-[[3-[4-[(2S,4R,5R,6S)-4-[4-(hydroxymethyl)phenyl]-5-methyl-6-(piperidin-1-ylmethyl)-1,3-dioxan-2-yl]phenyl]phenyl]methyl]urea.
| Compound Name | 1-(1-adamantyl)-3-[[3-[4-[(2S,4R,5R,6S)-4-[4-(hydroxymethyl)phenyl]-5-methyl-6-(piperidin-1-ylmethyl)-1,3-dioxan-2-yl]phenyl]phenyl]methyl]urea |
|---|---|
| PubChem CID | 6681820 |
| Molecular Formula | C42H53N3O4 |
| Molecular Weight | 663.90 g/mol |
| Exact Mass | 663.40 |
| IUPAC Name | 1-(1-adamantyl)-3-[[3-[4-[(2S,4R,5R,6S)-4-[4-(hydroxymethyl)phenyl]-5-methyl-6-(piperidin-1-ylmethyl)-1,3-dioxan-2-yl]phenyl]phenyl]methyl]urea |
| SMILES | C[C@H]1[C@@H](CN2CCCCC2)O[C@@H](c2ccc(-c3cccc(CNC(=O)NC45CC6CC(CC(C6)C4)C5)c3)cc2)O[C@H]1c1ccc(CO)cc1 |
| InChI | InChI=1S/C42H53N3O4/c1-28-38(26-45-16-3-2-4-17-45)48-40(49-39(28)35-10-8-29(27-46)9-11-35)36-14-12-34(13-15-36)37-7-5-6-30(21-37)25-43-41(47)44-42-22-31-18-32(23-42)20-33(19-31)24-42/h5-15,21,28,31-33,38-40,46H,2-4,16-20,22-27H2,1H3,(H2,43,44,47)/t28-,31?,32?,33?,38+,39+,40+,42?/m0/s1 |
| InChIKey | MKFOPUTWLIKLII-KKQPXPOKSA-N |
| XLogP | 7.89 |
| TPSA | 83.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 663.90 |
| LogP ≤ 5 | 7.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |