C36H49N3O4 — CID 6681797
1-(1-adamantyl)-3-[[4-[(2S,4R,5R,6S)-4-[4-(hydroxymethyl)phenyl]-5-methyl-6-(piperidin-1-ylmethyl)-1,3-dioxan-2-yl]phenyl]methyl]urea (PubChem CID 6681797) has the molecular formula C36H49N3O4 and a molecular weight of 587.81 g/mol. Its IUPAC name is 1-(1-adamantyl)-3-[[4-[(2S,4R,5R,6S)-4-[4-(hydroxymethyl)phenyl]-5-methyl-6-(piperidin-1-ylmethyl)-1,3-dioxan-2-yl]phenyl]methyl]urea.
| Compound Name | 1-(1-adamantyl)-3-[[4-[(2S,4R,5R,6S)-4-[4-(hydroxymethyl)phenyl]-5-methyl-6-(piperidin-1-ylmethyl)-1,3-dioxan-2-yl]phenyl]methyl]urea |
|---|---|
| PubChem CID | 6681797 |
| Molecular Formula | C36H49N3O4 |
| Molecular Weight | 587.81 g/mol |
| Exact Mass | 587.37 |
| IUPAC Name | 1-(1-adamantyl)-3-[[4-[(2S,4R,5R,6S)-4-[4-(hydroxymethyl)phenyl]-5-methyl-6-(piperidin-1-ylmethyl)-1,3-dioxan-2-yl]phenyl]methyl]urea |
| SMILES | C[C@H]1[C@@H](CN2CCCCC2)O[C@@H](c2ccc(CNC(=O)NC34CC5CC(CC(C5)C3)C4)cc2)O[C@H]1c1ccc(CO)cc1 |
| InChI | InChI=1S/C36H49N3O4/c1-24-32(22-39-13-3-2-4-14-39)42-34(43-33(24)30-9-7-26(23-40)8-10-30)31-11-5-25(6-12-31)21-37-35(41)38-36-18-27-15-28(19-36)17-29(16-27)20-36/h5-12,24,27-29,32-34,40H,2-4,13-23H2,1H3,(H2,37,38,41)/t24-,27?,28?,29?,32+,33+,34+,36?/m0/s1 |
| InChIKey | LALHEWSPYNSYKW-RLACRYAGSA-N |
| XLogP | 6.22 |
| TPSA | 83.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 587.81 |
| LogP ≤ 5 | 6.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |