C27H33Cl3N2O4 — CID 6687521
2,2,2-trichloro-N-[[4-[(2R,4S,5S,6R)-4-[4-(hydroxymethyl)phenyl]-5-methyl-6-(piperidin-1-ylmethyl)-1,3-dioxan-2-yl]phenyl]methyl]acetamide (PubChem CID 6687521) has the molecular formula C27H33Cl3N2O4 and a molecular weight of 555.93 g/mol. Its IUPAC name is 2,2,2-trichloro-N-[[4-[(2R,4S,5S,6R)-4-[4-(hydroxymethyl)phenyl]-5-methyl-6-(piperidin-1-ylmethyl)-1,3-dioxan-2-yl]phenyl]methyl]acetamide.
| Compound Name | 2,2,2-trichloro-N-[[4-[(2R,4S,5S,6R)-4-[4-(hydroxymethyl)phenyl]-5-methyl-6-(piperidin-1-ylmethyl)-1,3-dioxan-2-yl]phenyl]methyl]acetamide |
|---|---|
| PubChem CID | 6687521 |
| Molecular Formula | C27H33Cl3N2O4 |
| Molecular Weight | 555.93 g/mol |
| Exact Mass | 554.15 |
| IUPAC Name | 2,2,2-trichloro-N-[[4-[(2R,4S,5S,6R)-4-[4-(hydroxymethyl)phenyl]-5-methyl-6-(piperidin-1-ylmethyl)-1,3-dioxan-2-yl]phenyl]methyl]acetamide |
| SMILES | C[C@H]1C(c2ccc(CO)cc2)O[C@@H](c2ccc(CNC(=O)C(Cl)(Cl)Cl)cc2)O[C@H]1CN1CCCCC1 |
| InChI | InChI=1S/C27H33Cl3N2O4/c1-18-23(16-32-13-3-2-4-14-32)35-25(36-24(18)21-9-7-20(17-33)8-10-21)22-11-5-19(6-12-22)15-31-26(34)27(28,29)30/h5-12,18,23-25,33H,2-4,13-17H2,1H3,(H,31,34)/t18-,23+,24?,25+/m1/s1 |
| InChIKey | DOGXYLWPGRSSNO-IONKVMBWSA-N |
| XLogP | 5.44 |
| TPSA | 71.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.93 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|