C35H39Cl3N2O6 — CID 6684351
2,2,2-trichloro-N-[[2-[4-[(2S,4S,5R,6R)-4-(1,4-dioxa-8-azaspiro[4.5]decan-8-ylmethyl)-6-[4-(hydroxymethyl)phenyl]-5-methyl-1,3-dioxan-2-yl]phenyl]phenyl]methyl]acetamide (PubChem CID 6684351) has the molecular formula C35H39Cl3N2O6 and a molecular weight of 690.06 g/mol. Its IUPAC name is 2,2,2-trichloro-N-[[2-[4-[(2S,4S,5R,6R)-4-(1,4-dioxa-8-azaspiro[4.5]decan-8-ylmethyl)-6-[4-(hydroxymethyl)phenyl]-5-methyl-1,3-dioxan-2-yl]phenyl]phenyl]methyl]acetamide.
| Compound Name | 2,2,2-trichloro-N-[[2-[4-[(2S,4S,5R,6R)-4-(1,4-dioxa-8-azaspiro[4.5]decan-8-ylmethyl)-6-[4-(hydroxymethyl)phenyl]-5-methyl-1,3-dioxan-2-yl]phenyl]phenyl]methyl]acetamide |
|---|---|
| PubChem CID | 6684351 |
| Molecular Formula | C35H39Cl3N2O6 |
| Molecular Weight | 690.06 g/mol |
| Exact Mass | 688.19 |
| IUPAC Name | 2,2,2-trichloro-N-[[2-[4-[(2S,4S,5R,6R)-4-(1,4-dioxa-8-azaspiro[4.5]decan-8-ylmethyl)-6-[4-(hydroxymethyl)phenyl]-5-methyl-1,3-dioxan-2-yl]phenyl]phenyl]methyl]acetamide |
| SMILES | C[C@H]1[C@@H](CN2CCC3(CC2)OCCO3)O[C@@H](c2ccc(-c3ccccc3CNC(=O)C(Cl)(Cl)Cl)cc2)O[C@H]1c1ccc(CO)cc1 |
| InChI | InChI=1S/C35H39Cl3N2O6/c1-23-30(21-40-16-14-34(15-17-40)43-18-19-44-34)45-32(46-31(23)26-8-6-24(22-41)7-9-26)27-12-10-25(11-13-27)29-5-3-2-4-28(29)20-39-33(42)35(36,37)38/h2-13,23,30-32,41H,14-22H2,1H3,(H,39,42)/t23-,30+,31+,32+/m0/s1 |
| InChIKey | FUPJKKJVWIXXGM-RJTFWAQASA-N |
| XLogP | 6.46 |
| TPSA | 89.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 690.06 |
| LogP ≤ 5 | 6.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|