C28H33Cl3N2O6 — CID 6705635
2,2,2-trichloro-N-[4-[(2R,4R,5S,6S)-4-(1,4-dioxa-8-azaspiro[4.5]decan-8-ylmethyl)-6-[4-(hydroxymethyl)phenyl]-5-methyl-1,3-dioxan-2-yl]phenyl]acetamide (PubChem CID 6705635) has the molecular formula C28H33Cl3N2O6 and a molecular weight of 599.94 g/mol. Its IUPAC name is 2,2,2-trichloro-N-[4-[(2R,4R,5S,6S)-4-(1,4-dioxa-8-azaspiro[4.5]decan-8-ylmethyl)-6-[4-(hydroxymethyl)phenyl]-5-methyl-1,3-dioxan-2-yl]phenyl]acetamide.
| Compound Name | 2,2,2-trichloro-N-[4-[(2R,4R,5S,6S)-4-(1,4-dioxa-8-azaspiro[4.5]decan-8-ylmethyl)-6-[4-(hydroxymethyl)phenyl]-5-methyl-1,3-dioxan-2-yl]phenyl]acetamide |
|---|---|
| PubChem CID | 6705635 |
| Molecular Formula | C28H33Cl3N2O6 |
| Molecular Weight | 599.94 g/mol |
| Exact Mass | 598.14 |
| IUPAC Name | 2,2,2-trichloro-N-[4-[(2R,4R,5S,6S)-4-(1,4-dioxa-8-azaspiro[4.5]decan-8-ylmethyl)-6-[4-(hydroxymethyl)phenyl]-5-methyl-1,3-dioxan-2-yl]phenyl]acetamide |
| SMILES | C[C@@H]1[C@H](CN2CCC3(CC2)OCCO3)O[C@H](c2ccc(NC(=O)C(Cl)(Cl)Cl)cc2)O[C@@H]1c1ccc(CO)cc1 |
| InChI | InChI=1S/C28H33Cl3N2O6/c1-18-23(16-33-12-10-27(11-13-33)36-14-15-37-27)38-25(39-24(18)20-4-2-19(17-34)3-5-20)21-6-8-22(9-7-21)32-26(35)28(29,30)31/h2-9,18,23-25,34H,10-17H2,1H3,(H,32,35)/t18-,23+,24+,25+/m1/s1 |
| InChIKey | XTVJDXCCOQUGED-DNQHQPOYSA-N |
| XLogP | 5.12 |
| TPSA | 89.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 599.94 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|