C32H42N2O8 — CID 6684316
5-[[4-[(2S,4S,5R,6R)-4-(1,4-dioxa-8-azaspiro[4.5]decan-8-ylmethyl)-6-[4-(hydroxymethyl)phenyl]-5-methyl-1,3-dioxan-2-yl]phenyl]methylamino]-5-oxopentanoic acid (PubChem CID 6684316) has the molecular formula C32H42N2O8 and a molecular weight of 582.69 g/mol. Its IUPAC name is 5-[[4-[(2S,4S,5R,6R)-4-(1,4-dioxa-8-azaspiro[4.5]decan-8-ylmethyl)-6-[4-(hydroxymethyl)phenyl]-5-methyl-1,3-dioxan-2-yl]phenyl]methylamino]-5-oxopentanoic acid.
| Compound Name | 5-[[4-[(2S,4S,5R,6R)-4-(1,4-dioxa-8-azaspiro[4.5]decan-8-ylmethyl)-6-[4-(hydroxymethyl)phenyl]-5-methyl-1,3-dioxan-2-yl]phenyl]methylamino]-5-oxopentanoic acid |
|---|---|
| PubChem CID | 6684316 |
| Molecular Formula | C32H42N2O8 |
| Molecular Weight | 582.69 g/mol |
| Exact Mass | 582.29 |
| IUPAC Name | 5-[[4-[(2S,4S,5R,6R)-4-(1,4-dioxa-8-azaspiro[4.5]decan-8-ylmethyl)-6-[4-(hydroxymethyl)phenyl]-5-methyl-1,3-dioxan-2-yl]phenyl]methylamino]-5-oxopentanoic acid |
| SMILES | C[C@H]1[C@@H](CN2CCC3(CC2)OCCO3)O[C@@H](c2ccc(CNC(=O)CCCC(=O)O)cc2)O[C@H]1c1ccc(CO)cc1 |
| InChI | InChI=1S/C32H42N2O8/c1-22-27(20-34-15-13-32(14-16-34)39-17-18-40-32)41-31(42-30(22)25-9-7-24(21-35)8-10-25)26-11-5-23(6-12-26)19-33-28(36)3-2-4-29(37)38/h5-12,22,27,30-31,35H,2-4,13-21H2,1H3,(H,33,36)(H,37,38)/t22-,27+,30+,31+/m0/s1 |
| InChIKey | GIFYASBXJICXNU-DUBVAAOESA-N |
| XLogP | 3.68 |
| TPSA | 126.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.69 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |