C39H50ClN3O6 — CID 6692362
6-acetamido-N-[[4-[(2R,4R,5S,6S)-4-[[4-(4-chlorophenyl)-4-hydroxypiperidin-1-yl]methyl]-6-[4-(hydroxymethyl)phenyl]-5-methyl-1,3-dioxan-2-yl]phenyl]methyl]hexanamide (PubChem CID 6692362) has the molecular formula C39H50ClN3O6 and a molecular weight of 692.30 g/mol. Its IUPAC name is 6-acetamido-N-[[4-[(2R,4R,5S,6S)-4-[[4-(4-chlorophenyl)-4-hydroxypiperidin-1-yl]methyl]-6-[4-(hydroxymethyl)phenyl]-5-methyl-1,3-dioxan-2-yl]phenyl]methyl]hexanamide.
| Compound Name | 6-acetamido-N-[[4-[(2R,4R,5S,6S)-4-[[4-(4-chlorophenyl)-4-hydroxypiperidin-1-yl]methyl]-6-[4-(hydroxymethyl)phenyl]-5-methyl-1,3-dioxan-2-yl]phenyl]methyl]hexanamide |
|---|---|
| PubChem CID | 6692362 |
| Molecular Formula | C39H50ClN3O6 |
| Molecular Weight | 692.30 g/mol |
| Exact Mass | 691.34 |
| IUPAC Name | 6-acetamido-N-[[4-[(2R,4R,5S,6S)-4-[[4-(4-chlorophenyl)-4-hydroxypiperidin-1-yl]methyl]-6-[4-(hydroxymethyl)phenyl]-5-methyl-1,3-dioxan-2-yl]phenyl]methyl]hexanamide |
| SMILES | CC(=O)NCCCCCC(=O)NCc1ccc([C@@H]2OC(c3ccc(CO)cc3)[C@H](C)[C@H](CN3CCC(O)(c4ccc(Cl)cc4)CC3)O2)cc1 |
| InChI | InChI=1S/C39H50ClN3O6/c1-27-35(25-43-22-19-39(47,20-23-43)33-15-17-34(40)18-16-33)48-38(49-37(27)31-11-9-30(26-44)10-12-31)32-13-7-29(8-14-32)24-42-36(46)6-4-3-5-21-41-28(2)45/h7-18,27,35,37-38,44,47H,3-6,19-26H2,1-2H3,(H,41,45)(H,42,46)/t27-,35+,37?,38+/m1/s1 |
| InChIKey | HMUHBRACCVAZNT-WYPJPBFVSA-N |
| XLogP | 5.92 |
| TPSA | 120.36 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 692.30 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|