C36H44ClN3O7 — CID 6692364
ethyl 2-[[4-[(2R,4R,5S,6S)-4-[[4-(4-chlorophenyl)-4-hydroxypiperidin-1-yl]methyl]-6-[4-(hydroxymethyl)phenyl]-5-methyl-1,3-dioxan-2-yl]phenyl]methylcarbamoylamino]acetate (PubChem CID 6692364) has the molecular formula C36H44ClN3O7 and a molecular weight of 666.21 g/mol. Its IUPAC name is ethyl 2-[[4-[(2R,4R,5S,6S)-4-[[4-(4-chlorophenyl)-4-hydroxypiperidin-1-yl]methyl]-6-[4-(hydroxymethyl)phenyl]-5-methyl-1,3-dioxan-2-yl]phenyl]methylcarbamoylamino]acetate.
| Compound Name | ethyl 2-[[4-[(2R,4R,5S,6S)-4-[[4-(4-chlorophenyl)-4-hydroxypiperidin-1-yl]methyl]-6-[4-(hydroxymethyl)phenyl]-5-methyl-1,3-dioxan-2-yl]phenyl]methylcarbamoylamino]acetate |
|---|---|
| PubChem CID | 6692364 |
| Molecular Formula | C36H44ClN3O7 |
| Molecular Weight | 666.21 g/mol |
| Exact Mass | 665.29 |
| IUPAC Name | ethyl 2-[[4-[(2R,4R,5S,6S)-4-[[4-(4-chlorophenyl)-4-hydroxypiperidin-1-yl]methyl]-6-[4-(hydroxymethyl)phenyl]-5-methyl-1,3-dioxan-2-yl]phenyl]methylcarbamoylamino]acetate |
| SMILES | CCOC(=O)CNC(=O)NCc1ccc([C@@H]2OC(c3ccc(CO)cc3)[C@H](C)[C@H](CN3CCC(O)(c4ccc(Cl)cc4)CC3)O2)cc1 |
| InChI | InChI=1S/C36H44ClN3O7/c1-3-45-32(42)21-39-35(43)38-20-25-4-10-28(11-5-25)34-46-31(24(2)33(47-34)27-8-6-26(23-41)7-9-27)22-40-18-16-36(44,17-19-40)29-12-14-30(37)15-13-29/h4-15,24,31,33-34,41,44H,3,16-23H2,1-2H3,(H2,38,39,43)/t24-,31+,33?,34+/m1/s1 |
| InChIKey | QGKSNVAANBOXQP-ZGJQZSFVSA-N |
| XLogP | 4.97 |
| TPSA | 129.59 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 47 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 666.21 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |