C35H42ClN3O7 — CID 6706091
ethyl 2-[[4-[(2R,4R,5S,6S)-4-[[4-(4-chlorophenyl)-4-hydroxypiperidin-1-yl]methyl]-6-[4-(hydroxymethyl)phenyl]-5-methyl-1,3-dioxan-2-yl]phenyl]carbamoylamino]acetate (PubChem CID 6706091) has the molecular formula C35H42ClN3O7 and a molecular weight of 652.19 g/mol. Its IUPAC name is ethyl 2-[[4-[(2R,4R,5S,6S)-4-[[4-(4-chlorophenyl)-4-hydroxypiperidin-1-yl]methyl]-6-[4-(hydroxymethyl)phenyl]-5-methyl-1,3-dioxan-2-yl]phenyl]carbamoylamino]acetate.
| Compound Name | ethyl 2-[[4-[(2R,4R,5S,6S)-4-[[4-(4-chlorophenyl)-4-hydroxypiperidin-1-yl]methyl]-6-[4-(hydroxymethyl)phenyl]-5-methyl-1,3-dioxan-2-yl]phenyl]carbamoylamino]acetate |
|---|---|
| PubChem CID | 6706091 |
| Molecular Formula | C35H42ClN3O7 |
| Molecular Weight | 652.19 g/mol |
| Exact Mass | 651.27 |
| IUPAC Name | ethyl 2-[[4-[(2R,4R,5S,6S)-4-[[4-(4-chlorophenyl)-4-hydroxypiperidin-1-yl]methyl]-6-[4-(hydroxymethyl)phenyl]-5-methyl-1,3-dioxan-2-yl]phenyl]carbamoylamino]acetate |
| SMILES | CCOC(=O)CNC(=O)Nc1ccc([C@@H]2OC(c3ccc(CO)cc3)[C@H](C)[C@H](CN3CCC(O)(c4ccc(Cl)cc4)CC3)O2)cc1 |
| InChI | InChI=1S/C35H42ClN3O7/c1-3-44-31(41)20-37-34(42)38-29-14-8-26(9-15-29)33-45-30(23(2)32(46-33)25-6-4-24(22-40)5-7-25)21-39-18-16-35(43,17-19-39)27-10-12-28(36)13-11-27/h4-15,23,30,32-33,40,43H,3,16-22H2,1-2H3,(H2,37,38,42)/t23-,30+,32?,33+/m1/s1 |
| InChIKey | BWOGYJSICIONPM-HNPXWIJISA-N |
| XLogP | 5.29 |
| TPSA | 129.59 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 652.19 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |