C32H40N6O6 — CID 6704683
ethyl 2-[[4-[(2S,4R,5R,6S)-4-[4-(hydroxymethyl)phenyl]-5-methyl-6-[(4-pyrimidin-2-ylpiperazin-1-yl)methyl]-1,3-dioxan-2-yl]phenyl]carbamoylamino]acetate (PubChem CID 6704683) has the molecular formula C32H40N6O6 and a molecular weight of 604.71 g/mol. Its IUPAC name is ethyl 2-[[4-[(2S,4R,5R,6S)-4-[4-(hydroxymethyl)phenyl]-5-methyl-6-[(4-pyrimidin-2-ylpiperazin-1-yl)methyl]-1,3-dioxan-2-yl]phenyl]carbamoylamino]acetate.
| Compound Name | ethyl 2-[[4-[(2S,4R,5R,6S)-4-[4-(hydroxymethyl)phenyl]-5-methyl-6-[(4-pyrimidin-2-ylpiperazin-1-yl)methyl]-1,3-dioxan-2-yl]phenyl]carbamoylamino]acetate |
|---|---|
| PubChem CID | 6704683 |
| Molecular Formula | C32H40N6O6 |
| Molecular Weight | 604.71 g/mol |
| Exact Mass | 604.30 |
| IUPAC Name | ethyl 2-[[4-[(2S,4R,5R,6S)-4-[4-(hydroxymethyl)phenyl]-5-methyl-6-[(4-pyrimidin-2-ylpiperazin-1-yl)methyl]-1,3-dioxan-2-yl]phenyl]carbamoylamino]acetate |
| SMILES | CCOC(=O)CNC(=O)Nc1ccc([C@H]2OC(c3ccc(CO)cc3)[C@@H](C)[C@@H](CN3CCN(c4ncccn4)CC3)O2)cc1 |
| InChI | InChI=1S/C32H40N6O6/c1-3-42-28(40)19-35-32(41)36-26-11-9-25(10-12-26)30-43-27(22(2)29(44-30)24-7-5-23(21-39)6-8-24)20-37-15-17-38(18-16-37)31-33-13-4-14-34-31/h4-14,22,27,29-30,39H,3,15-21H2,1-2H3,(H2,35,36,41)/t22-,27+,29?,30+/m0/s1 |
| InChIKey | HOQKXTNZHCGLNY-BQMPPAMQSA-N |
| XLogP | 3.27 |
| TPSA | 138.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 604.71 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |