C37H45N5O7 — CID 6706135
ethyl 2-[[4-[(2R,4S,5S,6R)-4-[4-(hydroxymethyl)phenyl]-5-methyl-6-[(4-oxo-1-phenyl-1,3,8-triazaspiro[4.5]decan-8-yl)methyl]-1,3-dioxan-2-yl]phenyl]carbamoylamino]acetate (PubChem CID 6706135) has the molecular formula C37H45N5O7 and a molecular weight of 671.79 g/mol. Its IUPAC name is ethyl 2-[[4-[(2R,4S,5S,6R)-4-[4-(hydroxymethyl)phenyl]-5-methyl-6-[(4-oxo-1-phenyl-1,3,8-triazaspiro[4.5]decan-8-yl)methyl]-1,3-dioxan-2-yl]phenyl]carbamoylamino]acetate.
| Compound Name | ethyl 2-[[4-[(2R,4S,5S,6R)-4-[4-(hydroxymethyl)phenyl]-5-methyl-6-[(4-oxo-1-phenyl-1,3,8-triazaspiro[4.5]decan-8-yl)methyl]-1,3-dioxan-2-yl]phenyl]carbamoylamino]acetate |
|---|---|
| PubChem CID | 6706135 |
| Molecular Formula | C37H45N5O7 |
| Molecular Weight | 671.79 g/mol |
| Exact Mass | 671.33 |
| IUPAC Name | ethyl 2-[[4-[(2R,4S,5S,6R)-4-[4-(hydroxymethyl)phenyl]-5-methyl-6-[(4-oxo-1-phenyl-1,3,8-triazaspiro[4.5]decan-8-yl)methyl]-1,3-dioxan-2-yl]phenyl]carbamoylamino]acetate |
| SMILES | CCOC(=O)CNC(=O)Nc1ccc([C@H]2O[C@@H](CN3CCC4(CC3)C(=O)NCN4c3ccccc3)[C@@H](C)[C@@H](c3ccc(CO)cc3)O2)cc1 |
| InChI | InChI=1S/C37H45N5O7/c1-3-47-32(44)21-38-36(46)40-29-15-13-28(14-16-29)34-48-31(25(2)33(49-34)27-11-9-26(23-43)10-12-27)22-41-19-17-37(18-20-41)35(45)39-24-42(37)30-7-5-4-6-8-30/h4-16,25,31,33-34,43H,3,17-24H2,1-2H3,(H,39,45)(H2,38,40,46)/t25-,31+,33+,34+/m1/s1 |
| InChIKey | UHSCWVQHOUXHSL-DPGGFNHJSA-N |
| XLogP | 4.08 |
| TPSA | 141.70 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 49 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 671.79 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |