C36H45N5O5 — CID 6680411
1-ethyl-3-[[4-[(4R,5R,6S)-4-[4-(hydroxymethyl)phenyl]-5-methyl-6-[(4-oxo-1-phenyl-1,3,8-triazaspiro[4.5]decan-8-yl)methyl]-1,3-dioxan-2-yl]phenyl]methyl]urea (PubChem CID 6680411) has the molecular formula C36H45N5O5 and a molecular weight of 627.79 g/mol. Its IUPAC name is 1-ethyl-3-[[4-[(4R,5R,6S)-4-[4-(hydroxymethyl)phenyl]-5-methyl-6-[(4-oxo-1-phenyl-1,3,8-triazaspiro[4.5]decan-8-yl)methyl]-1,3-dioxan-2-yl]phenyl]methyl]urea.
| Compound Name | 1-ethyl-3-[[4-[(4R,5R,6S)-4-[4-(hydroxymethyl)phenyl]-5-methyl-6-[(4-oxo-1-phenyl-1,3,8-triazaspiro[4.5]decan-8-yl)methyl]-1,3-dioxan-2-yl]phenyl]methyl]urea |
|---|---|
| PubChem CID | 6680411 |
| Molecular Formula | C36H45N5O5 |
| Molecular Weight | 627.79 g/mol |
| Exact Mass | 627.34 |
| IUPAC Name | 1-ethyl-3-[[4-[(4R,5R,6S)-4-[4-(hydroxymethyl)phenyl]-5-methyl-6-[(4-oxo-1-phenyl-1,3,8-triazaspiro[4.5]decan-8-yl)methyl]-1,3-dioxan-2-yl]phenyl]methyl]urea |
| SMILES | CCNC(=O)NCc1ccc(C2O[C@H](CN3CCC4(CC3)C(=O)NCN4c3ccccc3)[C@H](C)[C@H](c3ccc(CO)cc3)O2)cc1 |
| InChI | InChI=1S/C36H45N5O5/c1-3-37-35(44)38-21-26-9-15-29(16-10-26)33-45-31(25(2)32(46-33)28-13-11-27(23-42)12-14-28)22-40-19-17-36(18-20-40)34(43)39-24-41(36)30-7-5-4-6-8-30/h4-16,25,31-33,42H,3,17-24H2,1-2H3,(H,39,43)(H2,37,38,44)/t25-,31+,32+,33?/m0/s1 |
| InChIKey | ITODZFHQCBLYNI-OIAPTSBUSA-N |
| XLogP | 4.22 |
| TPSA | 115.40 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 46 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 627.79 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |