C35H42N4O5 — CID 6692587
N-[[4-[(2R,4S,5S,6R)-4-[4-(hydroxymethyl)phenyl]-5-methyl-6-[(4-oxo-1-phenyl-1,3,8-triazaspiro[4.5]decan-8-yl)methyl]-1,3-dioxan-2-yl]phenyl]methyl]acetamide (PubChem CID 6692587) has the molecular formula C35H42N4O5 and a molecular weight of 598.74 g/mol. Its IUPAC name is N-[[4-[(2R,4S,5S,6R)-4-[4-(hydroxymethyl)phenyl]-5-methyl-6-[(4-oxo-1-phenyl-1,3,8-triazaspiro[4.5]decan-8-yl)methyl]-1,3-dioxan-2-yl]phenyl]methyl]acetamide.
| Compound Name | N-[[4-[(2R,4S,5S,6R)-4-[4-(hydroxymethyl)phenyl]-5-methyl-6-[(4-oxo-1-phenyl-1,3,8-triazaspiro[4.5]decan-8-yl)methyl]-1,3-dioxan-2-yl]phenyl]methyl]acetamide |
|---|---|
| PubChem CID | 6692587 |
| Molecular Formula | C35H42N4O5 |
| Molecular Weight | 598.74 g/mol |
| Exact Mass | 598.32 |
| IUPAC Name | N-[[4-[(2R,4S,5S,6R)-4-[4-(hydroxymethyl)phenyl]-5-methyl-6-[(4-oxo-1-phenyl-1,3,8-triazaspiro[4.5]decan-8-yl)methyl]-1,3-dioxan-2-yl]phenyl]methyl]acetamide |
| SMILES | CC(=O)NCc1ccc([C@H]2O[C@@H](CN3CCC4(CC3)C(=O)NCN4c3ccccc3)[C@@H](C)[C@@H](c3ccc(CO)cc3)O2)cc1 |
| InChI | InChI=1S/C35H42N4O5/c1-24-31(21-38-18-16-35(17-19-38)34(42)37-23-39(35)30-6-4-3-5-7-30)43-33(29-14-8-26(9-15-29)20-36-25(2)41)44-32(24)28-12-10-27(22-40)11-13-28/h3-15,24,31-33,40H,16-23H2,1-2H3,(H,36,41)(H,37,42)/t24-,31+,32+,33+/m1/s1 |
| InChIKey | FCZHLMZDPOSMPG-VHCVMOHBSA-N |
| XLogP | 4.03 |
| TPSA | 103.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 598.74 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |