C40H40N4O6 — CID 6692567
2-[3-[(2R,4S,5S,6R)-4-[4-(hydroxymethyl)phenyl]-5-methyl-6-[(4-oxo-1-phenyl-1,3,8-triazaspiro[4.5]decan-8-yl)methyl]-1,3-dioxan-2-yl]phenyl]isoindole-1,3-dione (PubChem CID 6692567) has the molecular formula C40H40N4O6 and a molecular weight of 672.78 g/mol. Its IUPAC name is 2-[3-[(2R,4S,5S,6R)-4-[4-(hydroxymethyl)phenyl]-5-methyl-6-[(4-oxo-1-phenyl-1,3,8-triazaspiro[4.5]decan-8-yl)methyl]-1,3-dioxan-2-yl]phenyl]isoindole-1,3-dione.
| Compound Name | 2-[3-[(2R,4S,5S,6R)-4-[4-(hydroxymethyl)phenyl]-5-methyl-6-[(4-oxo-1-phenyl-1,3,8-triazaspiro[4.5]decan-8-yl)methyl]-1,3-dioxan-2-yl]phenyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 6692567 |
| Molecular Formula | C40H40N4O6 |
| Molecular Weight | 672.78 g/mol |
| Exact Mass | 672.29 |
| IUPAC Name | 2-[3-[(2R,4S,5S,6R)-4-[4-(hydroxymethyl)phenyl]-5-methyl-6-[(4-oxo-1-phenyl-1,3,8-triazaspiro[4.5]decan-8-yl)methyl]-1,3-dioxan-2-yl]phenyl]isoindole-1,3-dione |
| SMILES | C[C@@H]1[C@H](CN2CCC3(CC2)C(=O)NCN3c2ccccc2)O[C@H](c2cccc(N3C(=O)c4ccccc4C3=O)c2)O[C@@H]1c1ccc(CO)cc1 |
| InChI | InChI=1S/C40H40N4O6/c1-26-34(23-42-20-18-40(19-21-42)39(48)41-25-43(40)30-9-3-2-4-10-30)49-38(50-35(26)28-16-14-27(24-45)15-17-28)29-8-7-11-31(22-29)44-36(46)32-12-5-6-13-33(32)37(44)47/h2-17,22,26,34-35,38,45H,18-21,23-25H2,1H3,(H,41,48)/t26-,34+,35+,38+/m1/s1 |
| InChIKey | AGOUKFHXOPOZGB-IQOKRNNPSA-N |
| XLogP | 5.20 |
| TPSA | 111.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 672.78 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|