C28H37N3O7 — CID 6704111
ethyl 2-[[4-[(2S,4R,5R,6S)-4-[4-(hydroxymethyl)phenyl]-6-[[(3S)-3-hydroxypyrrolidin-1-yl]methyl]-5-methyl-1,3-dioxan-2-yl]phenyl]carbamoylamino]acetate (PubChem CID 6704111) has the molecular formula C28H37N3O7 and a molecular weight of 527.62 g/mol. Its IUPAC name is ethyl 2-[[4-[(2S,4R,5R,6S)-4-[4-(hydroxymethyl)phenyl]-6-[[(3S)-3-hydroxypyrrolidin-1-yl]methyl]-5-methyl-1,3-dioxan-2-yl]phenyl]carbamoylamino]acetate.
| Compound Name | ethyl 2-[[4-[(2S,4R,5R,6S)-4-[4-(hydroxymethyl)phenyl]-6-[[(3S)-3-hydroxypyrrolidin-1-yl]methyl]-5-methyl-1,3-dioxan-2-yl]phenyl]carbamoylamino]acetate |
|---|---|
| PubChem CID | 6704111 |
| Molecular Formula | C28H37N3O7 |
| Molecular Weight | 527.62 g/mol |
| Exact Mass | 527.26 |
| IUPAC Name | ethyl 2-[[4-[(2S,4R,5R,6S)-4-[4-(hydroxymethyl)phenyl]-6-[[(3S)-3-hydroxypyrrolidin-1-yl]methyl]-5-methyl-1,3-dioxan-2-yl]phenyl]carbamoylamino]acetate |
| SMILES | CCOC(=O)CNC(=O)Nc1ccc([C@H]2OC(c3ccc(CO)cc3)[C@@H](C)[C@@H](CN3CC[C@H](O)C3)O2)cc1 |
| InChI | InChI=1S/C28H37N3O7/c1-3-36-25(34)14-29-28(35)30-22-10-8-21(9-11-22)27-37-24(16-31-13-12-23(33)15-31)18(2)26(38-27)20-6-4-19(17-32)5-7-20/h4-11,18,23-24,26-27,32-33H,3,12-17H2,1-2H3,(H2,29,30,35)/t18-,23-,24+,26?,27+/m0/s1 |
| InChIKey | CXVGEAHQPQZTOA-JCZWVDEPSA-N |
| XLogP | 2.72 |
| TPSA | 129.59 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.62 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |