C30H34Cl3N5O4 — CID 6690738
2,2,2-trichloro-N-[[4-[(2R,4S,5S,6R)-4-[4-(hydroxymethyl)phenyl]-5-methyl-6-[(4-pyrimidin-2-ylpiperazin-1-yl)methyl]-1,3-dioxan-2-yl]phenyl]methyl]acetamide (PubChem CID 6690738) has the molecular formula C30H34Cl3N5O4 and a molecular weight of 634.99 g/mol. Its IUPAC name is 2,2,2-trichloro-N-[[4-[(2R,4S,5S,6R)-4-[4-(hydroxymethyl)phenyl]-5-methyl-6-[(4-pyrimidin-2-ylpiperazin-1-yl)methyl]-1,3-dioxan-2-yl]phenyl]methyl]acetamide.
| Compound Name | 2,2,2-trichloro-N-[[4-[(2R,4S,5S,6R)-4-[4-(hydroxymethyl)phenyl]-5-methyl-6-[(4-pyrimidin-2-ylpiperazin-1-yl)methyl]-1,3-dioxan-2-yl]phenyl]methyl]acetamide |
|---|---|
| PubChem CID | 6690738 |
| Molecular Formula | C30H34Cl3N5O4 |
| Molecular Weight | 634.99 g/mol |
| Exact Mass | 633.17 |
| IUPAC Name | 2,2,2-trichloro-N-[[4-[(2R,4S,5S,6R)-4-[4-(hydroxymethyl)phenyl]-5-methyl-6-[(4-pyrimidin-2-ylpiperazin-1-yl)methyl]-1,3-dioxan-2-yl]phenyl]methyl]acetamide |
| SMILES | C[C@H]1C(c2ccc(CO)cc2)O[C@@H](c2ccc(CNC(=O)C(Cl)(Cl)Cl)cc2)O[C@H]1CN1CCN(c2ncccn2)CC1 |
| InChI | InChI=1S/C30H34Cl3N5O4/c1-20-25(18-37-13-15-38(16-14-37)29-34-11-2-12-35-29)41-27(42-26(20)23-7-5-22(19-39)6-8-23)24-9-3-21(4-10-24)17-36-28(40)30(31,32)33/h2-12,20,25-27,39H,13-19H2,1H3,(H,36,40)/t20-,25+,26?,27+/m1/s1 |
| InChIKey | XSAIHZAMZXQSED-OXBDOULZSA-N |
| XLogP | 4.57 |
| TPSA | 100.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 634.99 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|