C29H28Cl3N3O4 — CID 6683270
N-[[4-[(2S,4S,5R,6R)-4-(benzimidazol-1-ylmethyl)-6-[4-(hydroxymethyl)phenyl]-5-methyl-1,3-dioxan-2-yl]phenyl]methyl]-2,2,2-trichloroacetamide (PubChem CID 6683270) has the molecular formula C29H28Cl3N3O4 and a molecular weight of 588.92 g/mol. Its IUPAC name is N-[[4-[(2S,4S,5R,6R)-4-(benzimidazol-1-ylmethyl)-6-[4-(hydroxymethyl)phenyl]-5-methyl-1,3-dioxan-2-yl]phenyl]methyl]-2,2,2-trichloroacetamide.
| Compound Name | N-[[4-[(2S,4S,5R,6R)-4-(benzimidazol-1-ylmethyl)-6-[4-(hydroxymethyl)phenyl]-5-methyl-1,3-dioxan-2-yl]phenyl]methyl]-2,2,2-trichloroacetamide |
|---|---|
| PubChem CID | 6683270 |
| Molecular Formula | C29H28Cl3N3O4 |
| Molecular Weight | 588.92 g/mol |
| Exact Mass | 587.11 |
| IUPAC Name | N-[[4-[(2S,4S,5R,6R)-4-(benzimidazol-1-ylmethyl)-6-[4-(hydroxymethyl)phenyl]-5-methyl-1,3-dioxan-2-yl]phenyl]methyl]-2,2,2-trichloroacetamide |
| SMILES | C[C@H]1[C@@H](Cn2cnc3ccccc32)O[C@@H](c2ccc(CNC(=O)C(Cl)(Cl)Cl)cc2)O[C@H]1c1ccc(CO)cc1 |
| InChI | InChI=1S/C29H28Cl3N3O4/c1-18-25(15-35-17-34-23-4-2-3-5-24(23)35)38-27(39-26(18)21-10-8-20(16-36)9-11-21)22-12-6-19(7-13-22)14-33-28(37)29(30,31)32/h2-13,17-18,25-27,36H,14-16H2,1H3,(H,33,37)/t18-,25+,26+,27+/m0/s1 |
| InChIKey | CJBHVFXUKYZCBC-QUZACWSFSA-N |
| XLogP | 6.01 |
| TPSA | 85.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.92 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|