C35H32Cl3N3O4 — CID 6689083
N-[[3-[3-[(2R,4R,5S,6S)-4-(benzimidazol-1-ylmethyl)-6-[4-(hydroxymethyl)phenyl]-5-methyl-1,3-dioxan-2-yl]phenyl]phenyl]methyl]-2,2,2-trichloroacetamide (PubChem CID 6689083) has the molecular formula C35H32Cl3N3O4 and a molecular weight of 665.02 g/mol. Its IUPAC name is N-[[3-[3-[(2R,4R,5S,6S)-4-(benzimidazol-1-ylmethyl)-6-[4-(hydroxymethyl)phenyl]-5-methyl-1,3-dioxan-2-yl]phenyl]phenyl]methyl]-2,2,2-trichloroacetamide.
| Compound Name | N-[[3-[3-[(2R,4R,5S,6S)-4-(benzimidazol-1-ylmethyl)-6-[4-(hydroxymethyl)phenyl]-5-methyl-1,3-dioxan-2-yl]phenyl]phenyl]methyl]-2,2,2-trichloroacetamide |
|---|---|
| PubChem CID | 6689083 |
| Molecular Formula | C35H32Cl3N3O4 |
| Molecular Weight | 665.02 g/mol |
| Exact Mass | 663.15 |
| IUPAC Name | N-[[3-[3-[(2R,4R,5S,6S)-4-(benzimidazol-1-ylmethyl)-6-[4-(hydroxymethyl)phenyl]-5-methyl-1,3-dioxan-2-yl]phenyl]phenyl]methyl]-2,2,2-trichloroacetamide |
| SMILES | C[C@@H]1[C@H](Cn2cnc3ccccc32)O[C@H](c2cccc(-c3cccc(CNC(=O)C(Cl)(Cl)Cl)c3)c2)O[C@@H]1c1ccc(CO)cc1 |
| InChI | InChI=1S/C35H32Cl3N3O4/c1-22-31(19-41-21-40-29-10-2-3-11-30(29)41)44-33(45-32(22)25-14-12-23(20-42)13-15-25)28-9-5-8-27(17-28)26-7-4-6-24(16-26)18-39-34(43)35(36,37)38/h2-17,21-22,31-33,42H,18-20H2,1H3,(H,39,43)/t22-,31+,32+,33+/m1/s1 |
| InChIKey | MOJGUBLUUDCGAZ-OEHJXGRSSA-N |
| XLogP | 7.67 |
| TPSA | 85.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 665.02 |
| LogP ≤ 5 | 7.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|