C44H44N4O6 — CID 6683310
methyl (2S)-2-[[3-[4-[(2S,4S,5R,6R)-4-(benzimidazol-1-ylmethyl)-6-[4-(hydroxymethyl)phenyl]-5-methyl-1,3-dioxan-2-yl]phenyl]phenyl]methylcarbamoylamino]-3-phenylpropanoate (PubChem CID 6683310) has the molecular formula C44H44N4O6 and a molecular weight of 724.86 g/mol. Its IUPAC name is methyl (2S)-2-[[3-[4-[(2S,4S,5R,6R)-4-(benzimidazol-1-ylmethyl)-6-[4-(hydroxymethyl)phenyl]-5-methyl-1,3-dioxan-2-yl]phenyl]phenyl]methylcarbamoylamino]-3-phenylpropanoate.
| Compound Name | methyl (2S)-2-[[3-[4-[(2S,4S,5R,6R)-4-(benzimidazol-1-ylmethyl)-6-[4-(hydroxymethyl)phenyl]-5-methyl-1,3-dioxan-2-yl]phenyl]phenyl]methylcarbamoylamino]-3-phenylpropanoate |
|---|---|
| PubChem CID | 6683310 |
| Molecular Formula | C44H44N4O6 |
| Molecular Weight | 724.86 g/mol |
| Exact Mass | 724.33 |
| IUPAC Name | methyl (2S)-2-[[3-[4-[(2S,4S,5R,6R)-4-(benzimidazol-1-ylmethyl)-6-[4-(hydroxymethyl)phenyl]-5-methyl-1,3-dioxan-2-yl]phenyl]phenyl]methylcarbamoylamino]-3-phenylpropanoate |
| SMILES | COC(=O)[C@H](Cc1ccccc1)NC(=O)NCc1cccc(-c2ccc([C@@H]3O[C@H](Cn4cnc5ccccc54)[C@H](C)[C@H](c4ccc(CO)cc4)O3)cc2)c1 |
| InChI | InChI=1S/C44H44N4O6/c1-29-40(26-48-28-46-37-13-6-7-14-39(37)48)53-43(54-41(29)34-17-15-31(27-49)16-18-34)35-21-19-33(20-22-35)36-12-8-11-32(23-36)25-45-44(51)47-38(42(50)52-2)24-30-9-4-3-5-10-30/h3-23,28-29,38,40-41,43,49H,24-27H2,1-2H3,(H2,45,47,51)/t29-,38-,40+,41+,43+/m0/s1 |
| InChIKey | NQKYCLRKDDRYRC-JOSGNNOOSA-N |
| XLogP | 7.27 |
| TPSA | 123.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 724.86 |
| LogP ≤ 5 | 7.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |