C41H42N4O6S — CID 6688365
methyl (2S)-2-[[3-[4-[(2R,4S,5S,6R)-4-[4-(hydroxymethyl)phenyl]-5-methyl-6-(pyrimidin-2-ylsulfanylmethyl)-1,3-dioxan-2-yl]phenyl]phenyl]methylcarbamoylamino]-3-phenylpropanoate (PubChem CID 6688365) has the molecular formula C41H42N4O6S and a molecular weight of 718.88 g/mol. Its IUPAC name is methyl (2S)-2-[[3-[4-[(2R,4S,5S,6R)-4-[4-(hydroxymethyl)phenyl]-5-methyl-6-(pyrimidin-2-ylsulfanylmethyl)-1,3-dioxan-2-yl]phenyl]phenyl]methylcarbamoylamino]-3-phenylpropanoate.
| Compound Name | methyl (2S)-2-[[3-[4-[(2R,4S,5S,6R)-4-[4-(hydroxymethyl)phenyl]-5-methyl-6-(pyrimidin-2-ylsulfanylmethyl)-1,3-dioxan-2-yl]phenyl]phenyl]methylcarbamoylamino]-3-phenylpropanoate |
|---|---|
| PubChem CID | 6688365 |
| Molecular Formula | C41H42N4O6S |
| Molecular Weight | 718.88 g/mol |
| Exact Mass | 718.28 |
| IUPAC Name | methyl (2S)-2-[[3-[4-[(2R,4S,5S,6R)-4-[4-(hydroxymethyl)phenyl]-5-methyl-6-(pyrimidin-2-ylsulfanylmethyl)-1,3-dioxan-2-yl]phenyl]phenyl]methylcarbamoylamino]-3-phenylpropanoate |
| SMILES | COC(=O)[C@H](Cc1ccccc1)NC(=O)NCc1cccc(-c2ccc([C@@H]3OC(c4ccc(CO)cc4)[C@H](C)[C@H](CSc4ncccn4)O3)cc2)c1 |
| InChI | InChI=1S/C41H42N4O6S/c1-27-36(26-52-41-42-20-7-21-43-41)50-39(51-37(27)32-14-12-29(25-46)13-15-32)33-18-16-31(17-19-33)34-11-6-10-30(22-34)24-44-40(48)45-35(38(47)49-2)23-28-8-4-3-5-9-28/h3-22,27,35-37,39,46H,23-26H2,1-2H3,(H2,44,45,48)/t27-,35+,36+,37?,39+/m1/s1 |
| InChIKey | XTAJFYNIVZMCBE-YRSATECYSA-N |
| XLogP | 6.80 |
| TPSA | 131.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 718.88 |
| LogP ≤ 5 | 6.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |