C34H36N4O6S — CID 6688319
methyl (2S)-2-[[3-[(2R,4S,5S,6R)-4-[4-(hydroxymethyl)phenyl]-5-methyl-6-(pyrimidin-2-ylsulfanylmethyl)-1,3-dioxan-2-yl]phenyl]carbamoylamino]-3-phenylpropanoate (PubChem CID 6688319) has the molecular formula C34H36N4O6S and a molecular weight of 628.75 g/mol. Its IUPAC name is methyl (2S)-2-[[3-[(2R,4S,5S,6R)-4-[4-(hydroxymethyl)phenyl]-5-methyl-6-(pyrimidin-2-ylsulfanylmethyl)-1,3-dioxan-2-yl]phenyl]carbamoylamino]-3-phenylpropanoate.
| Compound Name | methyl (2S)-2-[[3-[(2R,4S,5S,6R)-4-[4-(hydroxymethyl)phenyl]-5-methyl-6-(pyrimidin-2-ylsulfanylmethyl)-1,3-dioxan-2-yl]phenyl]carbamoylamino]-3-phenylpropanoate |
|---|---|
| PubChem CID | 6688319 |
| Molecular Formula | C34H36N4O6S |
| Molecular Weight | 628.75 g/mol |
| Exact Mass | 628.24 |
| IUPAC Name | methyl (2S)-2-[[3-[(2R,4S,5S,6R)-4-[4-(hydroxymethyl)phenyl]-5-methyl-6-(pyrimidin-2-ylsulfanylmethyl)-1,3-dioxan-2-yl]phenyl]carbamoylamino]-3-phenylpropanoate |
| SMILES | COC(=O)[C@H](Cc1ccccc1)NC(=O)Nc1cccc([C@@H]2OC(c3ccc(CO)cc3)[C@H](C)[C@H](CSc3ncccn3)O2)c1 |
| InChI | InChI=1S/C34H36N4O6S/c1-22-29(21-45-34-35-16-7-17-36-34)43-32(44-30(22)25-14-12-24(20-39)13-15-25)26-10-6-11-27(19-26)37-33(41)38-28(31(40)42-2)18-23-8-4-3-5-9-23/h3-17,19,22,28-30,32,39H,18,20-21H2,1-2H3,(H2,37,38,41)/t22-,28+,29+,30?,32+/m1/s1 |
| InChIKey | OHPKFRBAGGSGBR-BJTQBBLVSA-N |
| XLogP | 5.46 |
| TPSA | 131.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 628.75 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |