C35H38N4O6S — CID 6682600
methyl (2S)-2-[[4-[(2S,4R,5R,6S)-4-[4-(hydroxymethyl)phenyl]-5-methyl-6-(pyrimidin-2-ylsulfanylmethyl)-1,3-dioxan-2-yl]phenyl]methylcarbamoylamino]-3-phenylpropanoate (PubChem CID 6682600) has the molecular formula C35H38N4O6S and a molecular weight of 642.78 g/mol. Its IUPAC name is methyl (2S)-2-[[4-[(2S,4R,5R,6S)-4-[4-(hydroxymethyl)phenyl]-5-methyl-6-(pyrimidin-2-ylsulfanylmethyl)-1,3-dioxan-2-yl]phenyl]methylcarbamoylamino]-3-phenylpropanoate.
| Compound Name | methyl (2S)-2-[[4-[(2S,4R,5R,6S)-4-[4-(hydroxymethyl)phenyl]-5-methyl-6-(pyrimidin-2-ylsulfanylmethyl)-1,3-dioxan-2-yl]phenyl]methylcarbamoylamino]-3-phenylpropanoate |
|---|---|
| PubChem CID | 6682600 |
| Molecular Formula | C35H38N4O6S |
| Molecular Weight | 642.78 g/mol |
| Exact Mass | 642.25 |
| IUPAC Name | methyl (2S)-2-[[4-[(2S,4R,5R,6S)-4-[4-(hydroxymethyl)phenyl]-5-methyl-6-(pyrimidin-2-ylsulfanylmethyl)-1,3-dioxan-2-yl]phenyl]methylcarbamoylamino]-3-phenylpropanoate |
| SMILES | COC(=O)[C@H](Cc1ccccc1)NC(=O)NCc1ccc([C@H]2OC(c3ccc(CO)cc3)[C@@H](C)[C@@H](CSc3ncccn3)O2)cc1 |
| InChI | InChI=1S/C35H38N4O6S/c1-23-30(22-46-35-36-17-6-18-37-35)44-33(45-31(23)27-13-11-26(21-40)12-14-27)28-15-9-25(10-16-28)20-38-34(42)39-29(32(41)43-2)19-24-7-4-3-5-8-24/h3-18,23,29-31,33,40H,19-22H2,1-2H3,(H2,38,39,42)/t23-,29-,30+,31?,33+/m0/s1 |
| InChIKey | HORQFUUBAQIHFE-IHPHWROVSA-N |
| XLogP | 5.14 |
| TPSA | 131.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 642.78 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |