C38H40N4O6 — CID 6689099
ethyl 2-[[3-[3-[(2R,4R,5S,6S)-4-(benzimidazol-1-ylmethyl)-6-[4-(hydroxymethyl)phenyl]-5-methyl-1,3-dioxan-2-yl]phenyl]phenyl]methylcarbamoylamino]acetate (PubChem CID 6689099) has the molecular formula C38H40N4O6 and a molecular weight of 648.76 g/mol. Its IUPAC name is ethyl 2-[[3-[3-[(2R,4R,5S,6S)-4-(benzimidazol-1-ylmethyl)-6-[4-(hydroxymethyl)phenyl]-5-methyl-1,3-dioxan-2-yl]phenyl]phenyl]methylcarbamoylamino]acetate.
| Compound Name | ethyl 2-[[3-[3-[(2R,4R,5S,6S)-4-(benzimidazol-1-ylmethyl)-6-[4-(hydroxymethyl)phenyl]-5-methyl-1,3-dioxan-2-yl]phenyl]phenyl]methylcarbamoylamino]acetate |
|---|---|
| PubChem CID | 6689099 |
| Molecular Formula | C38H40N4O6 |
| Molecular Weight | 648.76 g/mol |
| Exact Mass | 648.29 |
| IUPAC Name | ethyl 2-[[3-[3-[(2R,4R,5S,6S)-4-(benzimidazol-1-ylmethyl)-6-[4-(hydroxymethyl)phenyl]-5-methyl-1,3-dioxan-2-yl]phenyl]phenyl]methylcarbamoylamino]acetate |
| SMILES | CCOC(=O)CNC(=O)NCc1cccc(-c2cccc([C@H]3O[C@@H](Cn4cnc5ccccc54)[C@@H](C)[C@@H](c4ccc(CO)cc4)O3)c2)c1 |
| InChI | InChI=1S/C38H40N4O6/c1-3-46-35(44)21-40-38(45)39-20-27-8-6-9-29(18-27)30-10-7-11-31(19-30)37-47-34(22-42-24-41-32-12-4-5-13-33(32)42)25(2)36(48-37)28-16-14-26(23-43)15-17-28/h4-19,24-25,34,36-37,43H,3,20-23H2,1-2H3,(H2,39,40,45)/t25-,34+,36+,37+/m1/s1 |
| InChIKey | SWQBUCVFLMQHFM-XCRGKUJJSA-N |
| XLogP | 6.05 |
| TPSA | 123.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 648.76 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |