C36H45N3O7 — CID 6682323
ethyl 2-[[3-[3-[(2S,4R,5R,6S)-4-[4-(hydroxymethyl)phenyl]-6-[[(2S)-2-(hydroxymethyl)pyrrolidin-1-yl]methyl]-5-methyl-1,3-dioxan-2-yl]phenyl]phenyl]methylcarbamoylamino]acetate (PubChem CID 6682323) has the molecular formula C36H45N3O7 and a molecular weight of 631.77 g/mol. Its IUPAC name is ethyl 2-[[3-[3-[(2S,4R,5R,6S)-4-[4-(hydroxymethyl)phenyl]-6-[[(2S)-2-(hydroxymethyl)pyrrolidin-1-yl]methyl]-5-methyl-1,3-dioxan-2-yl]phenyl]phenyl]methylcarbamoylamino]acetate.
| Compound Name | ethyl 2-[[3-[3-[(2S,4R,5R,6S)-4-[4-(hydroxymethyl)phenyl]-6-[[(2S)-2-(hydroxymethyl)pyrrolidin-1-yl]methyl]-5-methyl-1,3-dioxan-2-yl]phenyl]phenyl]methylcarbamoylamino]acetate |
|---|---|
| PubChem CID | 6682323 |
| Molecular Formula | C36H45N3O7 |
| Molecular Weight | 631.77 g/mol |
| Exact Mass | 631.33 |
| IUPAC Name | ethyl 2-[[3-[3-[(2S,4R,5R,6S)-4-[4-(hydroxymethyl)phenyl]-6-[[(2S)-2-(hydroxymethyl)pyrrolidin-1-yl]methyl]-5-methyl-1,3-dioxan-2-yl]phenyl]phenyl]methylcarbamoylamino]acetate |
| SMILES | CCOC(=O)CNC(=O)NCc1cccc(-c2cccc([C@H]3OC(c4ccc(CO)cc4)[C@@H](C)[C@@H](CN4CCC[C@H]4CO)O3)c2)c1 |
| InChI | InChI=1S/C36H45N3O7/c1-3-44-33(42)20-38-36(43)37-19-26-7-4-8-28(17-26)29-9-5-10-30(18-29)35-45-32(21-39-16-6-11-31(39)23-41)24(2)34(46-35)27-14-12-25(22-40)13-15-27/h4-5,7-10,12-15,17-18,24,31-32,34-35,40-41H,3,6,11,16,19-23H2,1-2H3,(H2,37,38,43)/t24-,31-,32+,34?,35+/m0/s1 |
| InChIKey | YRKMWMAROIQKFF-VINMPINTSA-N |
| XLogP | 4.46 |
| TPSA | 129.59 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 46 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 631.77 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |