C47H69N3O6 — CID 6687147
ethyl 2-[[3-[3-[(2S,4S,5R,6R)-4-[(dioctylamino)methyl]-6-[4-(hydroxymethyl)phenyl]-5-methyl-1,3-dioxan-2-yl]phenyl]phenyl]methylcarbamoylamino]acetate (PubChem CID 6687147) has the molecular formula C47H69N3O6 and a molecular weight of 772.08 g/mol. Its IUPAC name is ethyl 2-[[3-[3-[(2S,4S,5R,6R)-4-[(dioctylamino)methyl]-6-[4-(hydroxymethyl)phenyl]-5-methyl-1,3-dioxan-2-yl]phenyl]phenyl]methylcarbamoylamino]acetate.
| Compound Name | ethyl 2-[[3-[3-[(2S,4S,5R,6R)-4-[(dioctylamino)methyl]-6-[4-(hydroxymethyl)phenyl]-5-methyl-1,3-dioxan-2-yl]phenyl]phenyl]methylcarbamoylamino]acetate |
|---|---|
| PubChem CID | 6687147 |
| Molecular Formula | C47H69N3O6 |
| Molecular Weight | 772.08 g/mol |
| Exact Mass | 771.52 |
| IUPAC Name | ethyl 2-[[3-[3-[(2S,4S,5R,6R)-4-[(dioctylamino)methyl]-6-[4-(hydroxymethyl)phenyl]-5-methyl-1,3-dioxan-2-yl]phenyl]phenyl]methylcarbamoylamino]acetate |
| SMILES | CCCCCCCCN(CCCCCCCC)C[C@H]1O[C@@H](c2cccc(-c3cccc(CNC(=O)NCC(=O)OCC)c3)c2)OC(c2ccc(CO)cc2)[C@H]1C |
| InChI | InChI=1S/C47H69N3O6/c1-5-8-10-12-14-16-28-50(29-17-15-13-11-9-6-2)34-43-36(4)45(39-26-24-37(35-51)25-27-39)56-46(55-43)42-23-19-22-41(31-42)40-21-18-20-38(30-40)32-48-47(53)49-33-44(52)54-7-3/h18-27,30-31,36,43,45-46,51H,5-17,28-29,32-35H2,1-4H3,(H2,48,49,53)/t36-,43+,45?,46+/m0/s1 |
| InChIKey | UTSHGZAPUUBNTD-LCYSUAKXSA-N |
| XLogP | 10.02 |
| TPSA | 109.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 25 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 772.08 |
| LogP ≤ 5 | 10.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|