C45H49N3O6 — CID 6691812
ethyl 2-[[3-[4-[(2R,4R,5S,6S)-4-[(dibenzylamino)methyl]-6-[4-(hydroxymethyl)phenyl]-5-methyl-1,3-dioxan-2-yl]phenyl]phenyl]methylcarbamoylamino]acetate (PubChem CID 6691812) has the molecular formula C45H49N3O6 and a molecular weight of 727.90 g/mol. Its IUPAC name is ethyl 2-[[3-[4-[(2R,4R,5S,6S)-4-[(dibenzylamino)methyl]-6-[4-(hydroxymethyl)phenyl]-5-methyl-1,3-dioxan-2-yl]phenyl]phenyl]methylcarbamoylamino]acetate.
| Compound Name | ethyl 2-[[3-[4-[(2R,4R,5S,6S)-4-[(dibenzylamino)methyl]-6-[4-(hydroxymethyl)phenyl]-5-methyl-1,3-dioxan-2-yl]phenyl]phenyl]methylcarbamoylamino]acetate |
|---|---|
| PubChem CID | 6691812 |
| Molecular Formula | C45H49N3O6 |
| Molecular Weight | 727.90 g/mol |
| Exact Mass | 727.36 |
| IUPAC Name | ethyl 2-[[3-[4-[(2R,4R,5S,6S)-4-[(dibenzylamino)methyl]-6-[4-(hydroxymethyl)phenyl]-5-methyl-1,3-dioxan-2-yl]phenyl]phenyl]methylcarbamoylamino]acetate |
| SMILES | CCOC(=O)CNC(=O)NCc1cccc(-c2ccc([C@@H]3OC(c4ccc(CO)cc4)[C@H](C)[C@H](CN(Cc4ccccc4)Cc4ccccc4)O3)cc2)c1 |
| InChI | InChI=1S/C45H49N3O6/c1-3-52-42(50)27-47-45(51)46-26-36-15-10-16-40(25-36)37-21-23-39(24-22-37)44-53-41(32(2)43(54-44)38-19-17-35(31-49)18-20-38)30-48(28-33-11-6-4-7-12-33)29-34-13-8-5-9-14-34/h4-25,32,41,43-44,49H,3,26-31H2,1-2H3,(H2,46,47,51)/t32-,41+,43?,44+/m1/s1 |
| InChIKey | RKWJYLAVXZZPBN-XYFKVYFTSA-N |
| XLogP | 7.70 |
| TPSA | 109.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 727.90 |
| LogP ≤ 5 | 7.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |