C35H31Cl3N2O4S2 — CID 6685407
N-[[3-[3-[(2S,4S,5R,6R)-4-(1,3-benzothiazol-2-ylsulfanylmethyl)-6-[4-(hydroxymethyl)phenyl]-5-methyl-1,3-dioxan-2-yl]phenyl]phenyl]methyl]-2,2,2-trichloroacetamide (PubChem CID 6685407) has the molecular formula C35H31Cl3N2O4S2 and a molecular weight of 714.14 g/mol. Its IUPAC name is N-[[3-[3-[(2S,4S,5R,6R)-4-(1,3-benzothiazol-2-ylsulfanylmethyl)-6-[4-(hydroxymethyl)phenyl]-5-methyl-1,3-dioxan-2-yl]phenyl]phenyl]methyl]-2,2,2-trichloroacetamide.
| Compound Name | N-[[3-[3-[(2S,4S,5R,6R)-4-(1,3-benzothiazol-2-ylsulfanylmethyl)-6-[4-(hydroxymethyl)phenyl]-5-methyl-1,3-dioxan-2-yl]phenyl]phenyl]methyl]-2,2,2-trichloroacetamide |
|---|---|
| PubChem CID | 6685407 |
| Molecular Formula | C35H31Cl3N2O4S2 |
| Molecular Weight | 714.14 g/mol |
| Exact Mass | 712.08 |
| IUPAC Name | N-[[3-[3-[(2S,4S,5R,6R)-4-(1,3-benzothiazol-2-ylsulfanylmethyl)-6-[4-(hydroxymethyl)phenyl]-5-methyl-1,3-dioxan-2-yl]phenyl]phenyl]methyl]-2,2,2-trichloroacetamide |
| SMILES | C[C@H]1[C@@H](CSc2nc3ccccc3s2)O[C@@H](c2cccc(-c3cccc(CNC(=O)C(Cl)(Cl)Cl)c3)c2)O[C@H]1c1ccc(CO)cc1 |
| InChI | InChI=1S/C35H31Cl3N2O4S2/c1-21-29(20-45-34-40-28-10-2-3-11-30(28)46-34)43-32(44-31(21)24-14-12-22(19-41)13-15-24)27-9-5-8-26(17-27)25-7-4-6-23(16-25)18-39-33(42)35(36,37)38/h2-17,21,29,31-32,41H,18-20H2,1H3,(H,39,42)/t21-,29+,31+,32+/m0/s1 |
| InChIKey | LQTYHKRJLYNPNO-LAKVWAJESA-N |
| XLogP | 9.03 |
| TPSA | 80.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 714.14 |
| LogP ≤ 5 | 9.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|