C41H45N3O5S2 — CID 6685421
6-acetamido-N-[[3-[3-[(2S,4S,5R,6R)-4-(1,3-benzothiazol-2-ylsulfanylmethyl)-6-[4-(hydroxymethyl)phenyl]-5-methyl-1,3-dioxan-2-yl]phenyl]phenyl]methyl]hexanamide (PubChem CID 6685421) has the molecular formula C41H45N3O5S2 and a molecular weight of 723.96 g/mol. Its IUPAC name is 6-acetamido-N-[[3-[3-[(2S,4S,5R,6R)-4-(1,3-benzothiazol-2-ylsulfanylmethyl)-6-[4-(hydroxymethyl)phenyl]-5-methyl-1,3-dioxan-2-yl]phenyl]phenyl]methyl]hexanamide.
| Compound Name | 6-acetamido-N-[[3-[3-[(2S,4S,5R,6R)-4-(1,3-benzothiazol-2-ylsulfanylmethyl)-6-[4-(hydroxymethyl)phenyl]-5-methyl-1,3-dioxan-2-yl]phenyl]phenyl]methyl]hexanamide |
|---|---|
| PubChem CID | 6685421 |
| Molecular Formula | C41H45N3O5S2 |
| Molecular Weight | 723.96 g/mol |
| Exact Mass | 723.28 |
| IUPAC Name | 6-acetamido-N-[[3-[3-[(2S,4S,5R,6R)-4-(1,3-benzothiazol-2-ylsulfanylmethyl)-6-[4-(hydroxymethyl)phenyl]-5-methyl-1,3-dioxan-2-yl]phenyl]phenyl]methyl]hexanamide |
| SMILES | CC(=O)NCCCCCC(=O)NCc1cccc(-c2cccc([C@@H]3O[C@H](CSc4nc5ccccc5s4)[C@H](C)[C@H](c4ccc(CO)cc4)O3)c2)c1 |
| InChI | InChI=1S/C41H45N3O5S2/c1-27-36(26-50-41-44-35-14-5-6-15-37(35)51-41)48-40(49-39(27)31-19-17-29(25-45)18-20-31)34-13-9-12-33(23-34)32-11-8-10-30(22-32)24-43-38(47)16-4-3-7-21-42-28(2)46/h5-6,8-15,17-20,22-23,27,36,39-40,45H,3-4,7,16,21,24-26H2,1-2H3,(H,42,46)(H,43,47)/t27-,36+,39+,40+/m0/s1 |
| InChIKey | NSMGHYVDOVVUKI-MCHPRGDUSA-N |
| XLogP | 8.35 |
| TPSA | 109.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 723.96 |
| LogP ≤ 5 | 8.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|