C38H38N2O6S2 — CID 6678293
6-[[3-[3-[(2S,4S,6R)-4-(1,3-benzothiazol-2-ylsulfanylmethyl)-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-2-yl]phenyl]phenyl]methylamino]-6-oxohexanoic acid (PubChem CID 6678293) has the molecular formula C38H38N2O6S2 and a molecular weight of 682.86 g/mol. Its IUPAC name is 6-[[3-[3-[(2S,4S,6R)-4-(1,3-benzothiazol-2-ylsulfanylmethyl)-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-2-yl]phenyl]phenyl]methylamino]-6-oxohexanoic acid.
| Compound Name | 6-[[3-[3-[(2S,4S,6R)-4-(1,3-benzothiazol-2-ylsulfanylmethyl)-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-2-yl]phenyl]phenyl]methylamino]-6-oxohexanoic acid |
|---|---|
| PubChem CID | 6678293 |
| Molecular Formula | C38H38N2O6S2 |
| Molecular Weight | 682.86 g/mol |
| Exact Mass | 682.22 |
| IUPAC Name | 6-[[3-[3-[(2S,4S,6R)-4-(1,3-benzothiazol-2-ylsulfanylmethyl)-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-2-yl]phenyl]phenyl]methylamino]-6-oxohexanoic acid |
| SMILES | O=C(O)CCCCC(=O)NCc1cccc(-c2cccc([C@@H]3O[C@H](CSc4nc5ccccc5s4)C[C@H](c4ccc(CO)cc4)O3)c2)c1 |
| InChI | InChI=1S/C38H38N2O6S2/c41-23-25-15-17-27(18-16-25)33-21-31(24-47-38-40-32-11-1-2-12-34(32)48-38)45-37(46-33)30-10-6-9-29(20-30)28-8-5-7-26(19-28)22-39-35(42)13-3-4-14-36(43)44/h1-2,5-12,15-20,31,33,37,41H,3-4,13-14,21-24H2,(H,39,42)(H,43,44)/t31-,33+,37+/m0/s1 |
| InChIKey | IDSTWSBLYLSUSC-HICSEYKMSA-N |
| XLogP | 8.05 |
| TPSA | 117.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 682.86 |
| LogP ≤ 5 | 8.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|